Feedback

3-(imidazol-5-yl)pyruvate

Properties
MNX_IDMNXM1103
formulaC6H5N2O3
charge-1
mass153.11558
referencechebi:58133
Image of MNXM1103
InChIKeyJEJNWEREQWMOHB-UHFFFAOYSA-M
InChIInChI=1S/C6H6N2O3/c9-5(6(10)11)1-4-2-7-3-8-4/h2-3H,1H2,(H,7,8)(H,10,11)/p-1
SMILES[O-]C(=O)C(=O)Cc1cnc[nH]1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref13
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:17406 3-(imidazol-5-yl)pyruvic acid
3-(1H-imidazol-5-yl)-2-oxopropanoic acid
3-(Imidazol-5-yl)pyruvate
Imidazol-5-yl-pyruvate
Imidazole pyruvate
Imidazole pyruvic acid
chebi:59013 3-(imidazol-4-yl)pyruvic acid
3-(1H-imidazol-4-yl)-2-oxopropanoic acid
chebi:11737
chebi:14433
chebi:24771
chebi:5871
keggC:M_C03277
seedM:M_cpd02091
secondary/obsolete/fantasy identifier
seedM:cpd02091 Imidazole pyruvate
3-(Imidazol-5-yl)pyruvate
3-(imidazol-5-yl)-pyruvate
Imidazol-5-yl-pyruvate
Imidazole pyruvic acid
imidazol-5-yl-pyruvate
imidazole-pyruvate
chebi:58133 3-(imidazol-5-yl)pyruvate
3-(1H-imidazol-5-yl)-2-oxopropanoate
3-(imidazol-5-yl)pyruvate anion
3-(imidazol-5-yl)pyruvate(1-)
metacycM:IMIDAZOLE-PYRUVATE imidazole-pyruvate
3-(imidazol-5-yl)-pyruvate
imidazol-5-yl-pyruvate
keggC:C03277 Imidazol-5-yl-pyruvate
3-(Imidazol-5-yl)pyruvate
Imidazole pyruvate
Imidazole pyruvic acid