Feedback

3-(imidazol-5-yl)pyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM1103Image of MNXM1103
#reac
in my sandbox 0
in MNXref (generic)13
in models (compartimentalized) 0
formulaC6H5N2O3
charge-1
mass153.11558
referencechebi:58133
InChIKeyJEJNWEREQWMOHB-UHFFFAOYSA-M
InChIInChI=1S/C6H6N2O3/c9-5(6(10)11)1-4-2-7-3-8-4/h2-3H,1H2,(H,7,8)(H,10,11)/p-1
SMILES[O-]C(=O)C(=O)Cc1cnc[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58133
chebi:58133
3-(imidazol-5-yl)pyruvate
3-(1H-imidazol-5-yl)-2-oxopropanoate
3-(imidazol-5-yl)pyruvate anion
3-(imidazol-5-yl)pyruvate(1-)
CHEBI:59013
chebi:59013
3-(imidazol-4-yl)pyruvic acid
3-(1H-imidazol-4-yl)-2-oxopropanoic acid
CHEBI:17406
chebi:17406
3-(imidazol-5-yl)pyruvic acid
3-(1H-imidazol-5-yl)-2-oxopropanoic acid
3-(Imidazol-5-yl)pyruvate
Imidazol-5-yl-pyruvate
Imidazole pyruvate
Imidazole pyruvic acid
kegg.compound:C03277
keggC:C03277
Imidazol-5-yl-pyruvate
3-(Imidazol-5-yl)pyruvate
Imidazole pyruvate
Imidazole pyruvic acid
seed.compound:cpd02091
seedM:cpd02091
Imidazole pyruvate
3-(Imidazol-5-yl)pyruvate
3-(imidazol-5-yl)-pyruvate
Imidazol-5-yl-pyruvate
Imidazole pyruvic acid
imidazol-5-yl-pyruvate
imidazole-pyruvate
metacyc.compound:IMIDAZOLE-PYRUVATE
metacycM:IMIDAZOLE-PYRUVATE
imidazole-pyruvate
3-(imidazol-5-yl)-pyruvate
imidazol-5-yl-pyruvate
chebi:11737
chebi:14433
chebi:24771
chebi:5871
keggC:M_C03277
seedM:M_cpd02091
secondary/obsolete/fantasy identifier