Feedback

(6S)-5,6,7,8-tetrahydrofolate

PropertiesImageOccurences in reactions
MNX_IDMNXM1103936Image of MNXM1103936
#reac
in my sandbox 0
in MNXref (generic)136
in models (compartimentalized) 164
formulaC19H21N7O6
charge-2
mass443.15643
referencechebi:57453
InChIKeyMSTNYGQPCMXVAQ-RYUDHWBXSA-L
InChIInChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t11-,12-/m0/s1
SMILESNc1nc2c(c(=O)[nH]1)N[C@@H](CNc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1)CN2
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57453
chebi:57453
(6S)-5,6,7,8-tetrahydrofolate
(6S)-5,6,7,8-tetrahydrofolate dianion
(6S)-5,6,7,8-tetrahydrofolate(2-)
N-[4-({[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamate
reactome:R-ALL-111355
reactomeM:R-ALL-111355
reactome:R-ALL-200671
reactomeM:R-ALL-200671
CHEBI:15635
chebi:15635
(6S)-5,6,7,8-tetrahydrofolic acid
(6S)-5,6,7,8-TETRAHYDROFOLATE
(6S)-5,6,7,8-tetrahydrofolate
(6S)-5,6,7,8-tetrahydropteroylglutamate
(6S)-H4folate
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
(6S)-tetrahydrofolate
5,6,7,8-Tetrahydrofolate
N-(5,6,7,8-tetrahydropteroyl)-L-glutamic acid
N-[4-({[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
THF
Tetrahydrofolate
Tetrahydrofolic acid
bigg.metabolite:thf
biggM:thf
5,6,7,8-Tetrahydrofolate
sabiork.compound:1297
sabiorkM:1297
5,6,7,8-Tetrahydrofolate
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
FH4
H4PteGlu1
THF
Tetrahydrofolate
Tetrahydrofolic acid
Tetrahydropteroylglutamate
CHEBI:68437
chebi:68437
5,6,7,8-tetrahydrofolate
(2S)-2-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl)amino]pentanedioate
5,6,7,8-tetrahydrofolate(2-)
metacyc.compound:THF
metacycM:THF
5,6,7,8-tetrahydrofolate
(6S)-tetrahydrofolate
5,6,7,8-tetrahydrofolic acid
FH4
H4F
H4PteGlu
H4PteGlu1
THF
folate-H4
tetra-H-folate
tetrahydrafolate
tetrahydrofolate
tetrahydrofolic acid
tetrahydropteroyl mono-L-glutamate
tetrahydropteroylglutamate
th-folate
vitamin B9
CHEBI:20506
chebi:20506
5,6,7,8-tetrahydrofolic acid
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
N-[4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl]-L-glutamic acid
THF
Tetrahydrofolic acid
tetrahydrofolate
tetrahydrofolic acid
seed.compound:cpd00087
seedM:cpd00087
Tetrahydrofolate
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
(6S)-tetrahydrofolate
5,6,7,8-Tetrahydrofolate
5,6,7,8-tetrahydrofolate
5,6,7,8-tetrahydrofolic acid
5-6-7-8-Tetrahydrofolate
FH4
H4F
H4PteGlu
H4PteGlu1
THF
Tetrahydrofolic acid
folate-H4
tetra-H-folate
tetrahydrafolate
tetrahydrofolate
tetrahydrofolic acid
tetrahydropteroyl mono-L-glutamate
tetrahydropteroylglutamate
th-folate
thf
vitamin B9
kegg.compound:C00101
keggC:C00101
Tetrahydrofolate
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
THF
Tetrahydrofolic acid
chebi:10931
chebi:12075
chebi:15220
chebi:18606
chebi:46069
chebi:9482
biggM:M_thf
keggC:M_C00101
seedM:M_cpd00087
secondary/obsolete/fantasy identifier