Feedback
[1-(2-amino-4-methylpentanamido)ethenyl]phosphonate
MNXM1105014 is deprecated and replaced by MNXM1105013
| Properties | Image |
| MNX_ID | MNXM1105013 |
 |
| reference | metacycM:CPD-12972 |
| formula | C8H17N2O4P |
| global charge | 0 |
| mol weight | 236.208 |
| InChIKey | SYMOEISBFNBXFQ-ZETCQYMHSA-N |
| InChI | InChI=1S/C8H17N2O4P/c1-5(2)4-7(9)8(11)10-6(3)15(12,13)14/h5,7H,3-4,9H2,1-2H3,(H,10,11)(H2,12,13,14)/t7-/m0/s1 |
| SMILES | C=C(NC(=O)[C@@H]([NH3+])CC(C)C)P(=O)([O-])O |
MNX internals
| InChI (mnx) | InChI=1/C8H17N2O4P/c1-5(2)4-7(9)8(11)10-6(3)15(12,13)14/h5,7H,3-4,9H2,1-2H3,(H,10,11)(H2,12,13,14)/t7-/m0/s1 |
 |
| SMILES (mnx) | [CH3:1][CH:5]([CH3:2])[CH2:4][C@@H:7]([C:8](=[N:10][C:6](=[CH2:3])[P:15]([OH:12])([OH:13])=[O:14])[OH:11])[NH2:9] |
|
| Parent-child relations graph |
| Occurences in reactions | #reac |
| in my sandbox |
0 |
| in MNXref (generic) | 2 |
| in models (compartimentalized) |
0 |
|