Feedback

D-glucose

PropertiesImageOccurences in reactions
MNX_IDMNXM1105029Image of MNXM1105029
#reac
in my sandbox 0
in MNXref (generic)534
in models (compartimentalized) 220
formulaC6H12O6
charge0
mass180.06339
referencechebi:4167
InChIKeyWQZGKKKJIJFFOK-GASJEMHNSA-N
InChIInChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1
SMILESOC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:4167
chebi:4167
D-glucose
D-Glc
D-Glcp
D-Glucose
D-glucopyranose
Dextrose
Glc-OH
Glucose
Grape sugar
WURCS=2.0/1,1,0/[a2122h-1x_1-5]/1/
glucose
bigg.metabolite:glc__D
biggM:glc__D
D-Glucose
hmdb:HMDB0000122 D-Glucose
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol
D Glucose
D-GLC
D-GLCP
D-Glucopyranose
D-Glucopyranoside
Dextrose
GLC-OH
Glucose
Glucose, (DL)-isomer
Glucose, (beta-D)-isomer
b-D-Glucopyranose
b-D-Glucose
b-Dextrose
b-Glucose
beta-D-Glucopyranose
beta-D-Glucopyranoside
beta-D-Glucose
beta-D-glucose
beta-Dextrose
beta-Glucose
glucoside
seed.compound:cpd00027
seedM:cpd00027
D-Glucose
D-(+)-Glucose
D-Glucopyranose
Dextrose
Glucopyranose
Glucose
Grape sugar
glc-D
kegg.compound:C00031
keggC:C00031
D-Glucose
D-Glucopyranose
Dextrose
Glucose
Grape sugar
sabiork.compound:1407
sabiorkM:1407
D-Glucose
Dextrose
Grape sugar
metacyc.compound:Glucopyranose
metacycM:Glucopyranose
D-glucopyranose
6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
kegg.drug:D00009
keggD:D00009
Glucose (JP18)
D-Glucose
Purified glucose (JP18)
metacyc.compound:Hederagenin-Monoglucosides
metacycM:Hederagenin-Monoglucosides
a hederagenin monoglucoside
metacyc.compound:Soyasapogenol-B-Monoglucosides
metacycM:Soyasapogenol-B-Monoglucosides
a soyasapogenol B monoglucoside
metacyc.compound:Soyasapogenol-E-Monoglucosides
metacycM:Soyasapogenol-E-Monoglucosides
a soyasapogenol E monoglucoside
biggM:glc
biggM:glc-D
hmdb:HMDB0000516
hmdb:HMDB0003340
hmdb:HMDB0006564
hmdb:HMDB00122
hmdb:HMDB00516
hmdb:HMDB0062170
hmdb:HMDB03340
hmdb:HMDB06564
hmdb:HMDB62170
biggM:M_glc__D
keggC:M_C00031
keggD:M_D00009
seedM:M_cpd00027
secondary/obsolete/fantasy identifier