Feedback

prostaglandin F2alpha

PropertiesImageOccurences in reactions
MNX_IDMNXM1105114Image of MNXM1105114
#reac
in my sandbox 0
in MNXref (generic)22
in models (compartimentalized) 27
formulaC20H33O5
charge-1
mass353.23335
referencechebi:57404
InChIKeyPXGPLTODNUVGFL-YNNPMVKQSA-M
InChIInChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/p-1/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1
SMILESCCCCC[C@H](O)/C=C/[C@H]1[C@H](O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57404
chebi:57404
prostaglandin F2alpha
(5Z,13E,15S)-9alpha,11alpha,15-trihydroxyprosta-5,13-dien-1-oate
prostaglandin F2alpha anion
prostaglandin F2alpha(1-)
kegg.drug:D00081
keggD:D00081
Dinoprost (JP18/USAN/INN)
Prosmon (TN)
lipidmaps:LMFA03010006
lipidmapsM:LMFA03010006
PGF2alpha-d4
9S,11R,15S-trihydroxy-5Z,13E-prostadienoic acid (3,3,4,4-d4)
Prostaglandin F2alpha-d4
lipidmaps:LMFA03010002
lipidmapsM:LMFA03010002
PGF2alpha
9S,11R,15S-trihydroxy-5Z,13E-prostadienoic acid
Amoglandin
Cyclosin
Dinoprost
Enzaprost
FA 20:3
O3
Prostaglandin F2a
Prostaglandin F2alpha
seed.compound:cpd00488
seedM:cpd00488
PGF2a
(+)-Prostaglandin F2a
(+)-prostaglandin F2a
(5Z,13E)-(15S)-9,11,15-trihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate
(5Z,9alpha,11alpha,13E,15S)-9,11,15-Trihydroxyprosta-5,13-dienoate
(5z,13e)-(15s)-9-alpha,11-alpha,15-trihydroxyprosta-5,13-dienoate
7-[3, 5-dihydroxy-2-(3-hydroxyl-1-octenyl) cyclopentyl]-5-heptenoic acid
7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid
9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid
9a,11a-PGF2
Amoglandin
Cyclosin
Dinaprost
Dinoprost
Enzaprost
Enzaprost F
Panacelan
Prostaglandin F2
Prostaglandin F2a
Prostaglandin F2alpha
Prostarmon F
Prostin F 2 alpha
Prostin F2 alpha
Protamodin
U 14583
amoglandin
cyclosin
dinaprost
dinoprost
enzaprost
enzaprost F
panacelan
prostaglandin F2
prostaglandin F2alpha
prostarmon F
prostin F2alpha
protamodin
sabiork.compound:22943
sabiorkM:22943
Prostaglandin F2
bigg.metabolite:prostgf2
biggM:prostgf2
Prostaglandin F2alpha
kegg.compound:C00639
keggC:C00639
Prostaglandin F2alpha
(+)-Prostaglandin F2a
(5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate
(5Z,9alpha,11alpha,13E,15S)-9,11,15-Trihydroxyprosta-5,13-dienoate
7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid
9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid
9a,11a-PGF2
Amoglandin
Cyclosin
Dinoprost
Enzaprost
Enzaprost F
PGF2a
Panacelan
Prostaglandin F2a
Prostin F 2 alpha
Protamodin
U 14583
sabiork.compound:5165
sabiorkM:5165
Prostaglandin F2alpha
(+)-Prostaglandin F2a
(5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate
7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid
7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoicacid
9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid
9a,11a-PGF2
Amoglandin
Cyclosin
Dinoprost
Enzaprost
Enzaprost F
PGF2a
Panacelan
Prostaglandin F2a
Prostin F 2 alpha
Protamodin
U 14583
SLM:000000437
slm:000000437
Prostaglandin F2
PGF2
metacyc.compound:5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY
metacycM:5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY
prostaglandin F2alpha
(+)-Prostaglandin F2a
(+)-prostaglandin F2a
(5Z,13E)-(15S)-9,11,15-trihydroxyprosta-5,13-dienoate
(5z,13e)-(15s)-9-alpha,11-alpha,15-trihydroxyprosta-5,13-dienoate
7-[3, 5-dihydroxy-2-(3-hydroxyl-1-octenyl) cyclopentyl]-5-heptenoic acid
Dinaprost
Enzaprost
Enzaprost F
PGF2a
Prostaglandin F2
Prostaglandin F2a
Prostarmon F
Prostin F2 alpha
Protamodin
amoglandin
cyclosin
dinaprost
dinoprost
enzaprost
enzaprost F
panacelan
prostaglandin F2
prostarmon F
prostin F2alpha
protamodin
reactome:R-ALL-391928
reactomeM:R-ALL-391928
reactome:R-ALL-879535
reactomeM:R-ALL-879535
reactome:R-ALL-879657
reactomeM:R-ALL-879657
CHEBI:15553
chebi:15553
prostaglandin F2alpha
(+)-Prostaglandin F2a
(5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate
(5Z,13E,15S)-9alpha,11alpha,15-trihydroxyprosta-5,13-dien-1-oic acid
7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid
9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid
9a,11a-PGF2
Amoglandin
Cyclosin
Dinoprost
Enzaprost
Enzaprost F
PGF2a
PGF2alpha
Panacelan
Prostaglandin F2a
Prostaglandin F2alpha
Prostin F 2 alpha
Protamodin
U 14583
dinoprost
dinoprosta
dinoprostum
l-PGF2-alpha
l-Prostaglandin F2-alpha
chebi:10913
chebi:26327
chebi:8516
biggM:M_prostgf2
keggC:M_C00639
keggD:M_D00081
seedM:M_cpd00488
secondary/obsolete/fantasy identifier