Feedback

kynurenate

PropertiesImageOccurences in reactions
MNX_IDMNXM1113Image of MNXM1113
#reac
in my sandbox 0
in MNXref (generic)26
in models (compartimentalized) 22
formulaC10H6NO3
charge-1
mass188.03532
referencechebi:58454
InChIKeyHCZHHEIFKROPDY-UHFFFAOYSA-M
InChIInChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14)/p-1
SMILESO=C([O-])c1cc(O)c2ccccc2n1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58454
chebi:58454
kynurenate
4-hydroxyquinoline-2-carboxylate
bigg.metabolite:kynate
biggM:kynate
4-Hydroxy-2-quinolinecarboxylic acid
sabiork.compound:5750
sabiorkM:5750
kegg.compound:C01717
keggC:C01717
4-Hydroxy-2-quinolinecarboxylic acid
Kynurenate
Kynurenic acid
seed.compound:cpd01182
seedM:cpd01182
Kynurenate
4-Hydroxy-2-quinolinecarboxylic acid
Kynurenic acid
Quinaldic acid, 4-hydroxy-
kynurenate
kynurenic acid
hmdb:HMDB0000715 Kynurenic acid
2-Carboxy-4-hydroxyquinoline
4-Hydroxy-2-chinolincarbonsaeure
4-Hydroxy-2-quinolinecarboxylate
4-Hydroxy-2-quinolinecarboxylic acid
4-Hydroxy-quinaldate
4-Hydroxy-quinaldic acid
4-Hydroxyquinaldate
4-Hydroxyquinaldic acid
4-Hydroxyquinaldinate
4-Hydroxyquinaldinic acid
4-Hydroxyquinoline-2-carboxylate
4-Hydroxyquinoline-2-carboxylic acid
4-oxo-1,4-dihydroquinoline-2-carboxylic acid
Acid, kynurenic
Kynurenate
Kynurensaeure
Quinurenic acid
acid, kynurenic
metacyc.compound:KYNURENATE
metacycM:KYNURENATE
kynurenate
Quinaldic acid, 4-hydroxy-
kynurenic acid
reactome:R-ALL-893587
reactomeM:R-ALL-893587
reactome:R-ALL-893594
reactomeM:R-ALL-893594
CHEBI:18344
chebi:18344
kynurenic acid
4-Hydroxy-2-chinolincarbonsaeure
4-Hydroxy-2-quinolinecarboxylic acid
4-hydroxy-2-quinolinecarboxylic acid
4-hydroxyquinaldic acid
4-hydroxyquinaldinic acid
4-hydroxyquinoline-2-carboxylic acid
Kynurenate
Kynurenic acid
Kynurensaeure
hmdb:HMDB00715
chebi:14495
chebi:1841
chebi:20378
chebi:24991
biggM:M_kynate
keggC:M_C01717
seedM:M_cpd01182
secondary/obsolete/fantasy identifier