Feedback

kynurenate

Properties
MNX_IDMNXM1113
formulaC10H6NO3
charge-1
mass188.15958
referencechebi:58454
Image of MNXM1113
InChIKeyHCZHHEIFKROPDY-UHFFFAOYSA-M
InChIInChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14)/p-1
SMILESOc1cc(nc2ccccc12)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models9

Similar chemical compounds in external resources
IdentifierDescription
keggC:C01717
sabiorkM:5750
4-Hydroxy-2-quinolinecarboxylic acid
Kynurenate
Kynurenic acid
chebi:58454 kynurenate
4-hydroxyquinoline-2-carboxylate
metacycM:KYNURENATE kynurenate
Quinaldic acid, 4-hydroxy-
kynurenic acid
hmdb:HMDB0000715 Kynurenic acid
2-Carboxy-4-hydroxyquinoline
4-Hydroxy-2-chinolincarbonsaeure
4-Hydroxy-2-quinolinecarboxylate
4-Hydroxy-2-quinolinecarboxylic acid
4-Hydroxy-quinaldate
4-Hydroxy-quinaldic acid
4-Hydroxyquinaldate
4-Hydroxyquinaldic acid
4-Hydroxyquinaldinate
4-Hydroxyquinaldinic acid
4-Hydroxyquinoline-2-carboxylate
4-Hydroxyquinoline-2-carboxylic acid
4-oxo-1,4-dihydroquinoline-2-carboxylic acid
Acid, kynurenic
Kynurenate
Kynurensaeure
Quinurenic acid
acid, kynurenic
biggM:M_kynate
chebi:14495
chebi:1841
chebi:20378
chebi:24991
hmdb:HMDB00715
keggC:M_C01717
seedM:M_cpd01182
secondary/obsolete/fantasy identifier
biggM:kynate 4-Hydroxy-2-quinolinecarboxylic acid
chebi:18344
reactome:R-ALL-893587
reactome:R-ALL-893594
kynurenic acid
4-Hydroxy-2-chinolincarbonsaeure
4-Hydroxy-2-quinolinecarboxylic acid
4-hydroxy-2-quinolinecarboxylic acid
4-hydroxyquinaldic acid
4-hydroxyquinaldinic acid
4-hydroxyquinoline-2-carboxylic acid
Kynurenate
Kynurenic acid
Kynurensaeure
seedM:cpd01182 Kynurenate
4-Hydroxy-2-quinolinecarboxylic acid
Kynurenic acid
Quinaldic acid, 4-hydroxy-
kynurenate
kynurenic acid
MNXM92402is deprecated and replaced by this entry
MNXM92974is deprecated and replaced by this entry