Feedback

1-aminocyclopropane-1-carboxylate

Properties
MNX_IDMNXM1128
formulaC4H7NO2
charge0
mass101.10392
referencechebi:58360
Image of MNXM1128
InChIKeyPAJPWUMXBYXFCZ-UHFFFAOYSA-N
InChIInChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7)
SMILES[NH3+]C1(CC1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
chebi:58360 1-aminocyclopropane-1-carboxylate
1-aminocyclopropanecarboxylic acid zwitterion
1-ammoniocyclopropanecarboxylate
1-azaniumylcyclopropanecarboxylate
chebi:18053 1-aminocyclopropanecarboxylic acid
1-AMINOCYCLOPROPANECARBOXYLIC ACID
1-Aminocyclopropane-1-carboxylic acid
1-aminocyclopropane-1-carboxylic acid
ACC
seedM:cpd00909 1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid
1-aminocyclopropane-1-carboxylate
1-aminocyclopropane-1-carboxylic acid
1-aminocyclopropanecarboxylate
1-aminocyclopropanecarboxylic acid
ACC
biggM:1acpc
envipath:...9c6d411c4476
1-Aminocyclopropane-1-carboxylate
chebi:30526 1-aminocyclopropanecarboxylate
1-aminocyclopropane-1-carboxylate
ACC
hmdb:HMDB0036458 1-Aminocyclopropanecarboxylic acid
1-Aminocyclopropane carboxylic acid
1-Aminocyclopropane-1-1-carboxylic acid
1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid
1-Aminocyclopropane-1-carboxylic acid hydrochloride
1-Aminocyclopropane-1-carboxylic acid, 14C-labeled
1-Aminocyclopropanecarboxylate
1-Aminocyclopropanecarboxylic acid hydrochloride
1-amino-1-Carboxycyclopropane
1-amino-Cyclopropanecarboxylic acid
1-aminocyclopropane-1-carboxylic acid
ACC
ACC acid
ACPC
Aminocyclopropane carboxylic acid
alpha-Aminocyclopropane carboxylic acid
alpha-Aminocyclopropanecarboxylic acid
metacycM:CPD-68 1-aminocyclopropane-1-carboxylate
1-aminocyclopropane-1-carboxylic acid
1-aminocyclopropanecarboxylate
1-aminocyclopropanecarboxylic acid
ACC
biggM:M_1acpc
chebi:11251
chebi:19026
chebi:19027
chebi:19028
chebi:39590
chebi:609
hmdb:HMDB36458
keggC:M_C01234
seedM:M_cpd00909
secondary/obsolete/fantasy identifier
keggC:C01234
sabiorkM:5462
1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid