Feedback

1-aminocyclopropane-1-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1128Image of MNXM1128
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 1
formulaC4H7NO2
charge0
mass101.10392
referencechebi:58360
InChIKeyPAJPWUMXBYXFCZ-UHFFFAOYSA-N
InChIInChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7)
SMILES[NH3+]C1(CC1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58360
chebi:58360
1-aminocyclopropane-1-carboxylate
1-aminocyclopropanecarboxylic acid zwitterion
1-ammoniocyclopropanecarboxylate
1-azaniumylcyclopropanecarboxylate
bigg.metabolite:1acpc
biggM:1acpc
envipath:...9c6d411c4476
envipathM:...9c6d411c4476
1-Aminocyclopropane-1-carboxylate
sabiork.compound:5462
sabiorkM:5462
kegg.compound:C01234
keggC:C01234
1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid
seed.compound:cpd00909
seedM:cpd00909
1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid
1-aminocyclopropane-1-carboxylate
1-aminocyclopropane-1-carboxylic acid
1-aminocyclopropanecarboxylate
1-aminocyclopropanecarboxylic acid
ACC
hmdb:HMDB0036458 1-Aminocyclopropanecarboxylic acid
1-Aminocyclopropane carboxylic acid
1-Aminocyclopropane-1-1-carboxylic acid
1-Aminocyclopropane-1-carboxylate
1-Aminocyclopropane-1-carboxylic acid
1-Aminocyclopropane-1-carboxylic acid hydrochloride
1-Aminocyclopropane-1-carboxylic acid, 14C-labeled
1-Aminocyclopropanecarboxylate
1-Aminocyclopropanecarboxylic acid hydrochloride
1-amino-1-Carboxycyclopropane
1-amino-Cyclopropanecarboxylic acid
1-aminocyclopropane-1-carboxylic acid
ACC
ACC acid
ACPC
Aminocyclopropane carboxylic acid
alpha-Aminocyclopropane carboxylic acid
alpha-Aminocyclopropanecarboxylic acid
metacyc.compound:CPD-68
metacycM:CPD-68
1-aminocyclopropane-1-carboxylate
1-aminocyclopropane-1-carboxylic acid
1-aminocyclopropanecarboxylate
1-aminocyclopropanecarboxylic acid
ACC
CHEBI:30526
chebi:30526
1-aminocyclopropanecarboxylate
1-aminocyclopropane-1-carboxylate
ACC
CHEBI:18053
chebi:18053
1-aminocyclopropanecarboxylic acid
1-AMINOCYCLOPROPANECARBOXYLIC ACID
1-Aminocyclopropane-1-carboxylic acid
1-aminocyclopropane-1-carboxylic acid
ACC
hmdb:HMDB36458
chebi:11251
chebi:19026
chebi:19027
chebi:19028
chebi:39590
chebi:609
biggM:M_1acpc
keggC:M_C01234
seedM:M_cpd00909
secondary/obsolete/fantasy identifier