Feedback

1-hydroxy-2-naphthoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1129Image of MNXM1129
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 1
formulaC11H7O3
charge-1
mass187.04007
referencechebi:15992
InChIKeySJJCQDRGABAVBB-UHFFFAOYSA-M
InChIInChI=1S/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14)/p-1
SMILESO=C([O-])c1ccc2ccccc2c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15992
chebi:15992
1-hydroxy-2-naphthoate
1-hydroxy-2-naphthoate(1-)
envipath:...0d2855d93e47
envipathM:...0d2855d93e47
1-Hydroxy-2-naphthoate
kegg.compound:C03203
keggC:C03203
1-Hydroxy-2-naphthoate
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
seed.compound:cpd02045
seedM:cpd02045
1-Hydroxy-2-naphthoate
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
1-hydroxy-2-naphthoate
metacyc.compound:HYDROXYNAPHTHOATE
metacycM:HYDROXYNAPHTHOATE
1-hydroxy-2-naphthoate
CHEBI:36108
chebi:36108
1-hydroxy-2-naphthoic acid
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
1-hydroxy-2-naphthalenecarboxylic acid
1-hydroxynaphthalene-2-carboxylic acid
2-carboxy-1-naphthol
chebi:11261
chebi:19049
chebi:19050
chebi:634
keggC:M_C03203
seedM:M_cpd02045
secondary/obsolete/fantasy identifier