Feedback

1-hydroxy-2-naphthoate

Properties
MNX_IDMNXM1129
formulaC11H7O3
charge-1
mass187.17148
referencechebi:15992
Image of MNXM1129
InChIKeySJJCQDRGABAVBB-UHFFFAOYSA-M
InChIInChI=1S/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14)/p-1
SMILESOc1c(ccc2ccccc12)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
metacycM:HYDROXYNAPHTHOATE 1-hydroxy-2-naphthoate
chebi:15992 1-hydroxy-2-naphthoate
1-hydroxy-2-naphthoate(1-)
seedM:cpd02045 1-Hydroxy-2-naphthoate
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
1-hydroxy-2-naphthoate
keggC:C03203 1-Hydroxy-2-naphthoate
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
chebi:36108 1-hydroxy-2-naphthoic acid
1-Hydroxy-2-naphthoic acid
1-Naphthol-2-carboxylic acid
1-hydroxy-2-naphthalenecarboxylic acid
1-hydroxynaphthalene-2-carboxylic acid
2-carboxy-1-naphthol
envipath:...0d2855d93e47 1-Hydroxy-2-naphthoate
chebi:11261
chebi:19049
chebi:19050
chebi:634
keggC:M_C03203
seedM:M_cpd02045
secondary/obsolete/fantasy identifier