Feedback

3-carboxy-cis,cis-muconate

PropertiesImageOccurences in reactions
MNX_IDMNXM1134Image of MNXM1134
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 5
formulaC7H3O6
charge-3
mass182.99461
referencechebi:57496
InChIKeyKJOVGYUGXHIVAY-BXTBVDPRSA-K
InChIInChI=1S/C7H6O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h1-3H,(H,8,9)(H,10,11)(H,12,13)/p-3/b2-1-,4-3+
SMILESO=C([O-])/C=C\C(=C/C(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57496
chebi:57496
3-carboxy-cis,cis-muconate
(1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylate
3-carboxy-cis,cis-muconate trianion
3-carboxy-cis,cis-muconate(3-)
envipath:...8fd83d2a0c6e
envipathM:...8fd83d2a0c6e
3-Carboxy-cis,cis-muconate
seed.compound:cpd00856
seedM:cpd00856
3-Carboxy-cis,cis-muconate
(1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylate
3-carboxy-cis,cis-muconate
3cmuc
beta-Carboxy-cis,cis-muconate
beta-carboxy-cis,cis-muconate
cis,cis-Butadiene-1,2,4-tricarboxylate
cis,cis-butadiene-1,2,4-tricarboxylate
sabiork.compound:5415
sabiorkM:5415
kegg.compound:C01163
keggC:C01163
3-Carboxy-cis,cis-muconate
beta-Carboxy-cis,cis-muconate
cis,cis-Butadiene-1,2,4-tricarboxylate
metacyc.compound:CPD-245
metacycM:CPD-245
3-carboxy-cis,cis-muconate
(1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylate
beta-carboxy-cis,cis-muconate
cis,cis-butadiene-1,2,4-tricarboxylate
CHEBI:15749
chebi:15749
3-carboxy-cis,cis-muconic acid
(1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylic acid
3-Carboxy-cis,cis-muconate
3-carboxy-cis,cis-muconate
beta-Carboxy-cis,cis-muconate
beta-carboxy-cis,cis-muconate
cis,cis-Butadiene-1,2,4-tricarboxylate
cis,cis-butadiene-1,2,4-tricarboxylate
bigg.metabolite:CCbuttc
biggM:CCbuttc
Cis,cis-Butadiene-1,2,4-tricarboxylate
envipath:...9e80d32490f5
envipathM:...9e80d32490f5
compound 42290
chebi:11766
chebi:11767
chebi:12801
chebi:1468
chebi:19976
biggM:M_CCbuttc
keggC:M_C01163
seedM:M_cpd00856
secondary/obsolete/fantasy identifier