Search MNXref
 Feedback

3,4-dihydroxybenzoate

PropertiesImage
MNX_IDMNXM1137687 Image of MNXM1137687
referencechebi:36241
formulaC7H5O4
global charge-1
mol weight153.113
InChIKeyYQUVCSBJEUQKSH-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11)/p-1
SMILESO=C([O-])C1=CC(O)=C(O)C=C1
MNX internals
InChI (mnx)InChI=1/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11) Image of MNXM1137687
SMILES (mnx)[CH:1]1=[CH:2][C:5]([OH:8])=[C:6]([OH:9])[CH:3]=[C:4]1[C:7](=[O:10])[OH:11]
Parent-child relations graph
Occurences in reactions#reac
in my sandbox 0
in MNXref (generic)57
in models (compartimentalized) 17
Similar chemical compounds in external resources
IdentifierDescription

CHEBI:36241
chebi:36241
YQUVCSBJEUQKSH-UHFFFAOYSA-M
3,4-dihydroxybenzoate
3,4-Dihydroxybenzoate
4,5-dihydroxybenzoate

seed.compound:cpd28745
seedM:cpd28745
YQUVCSBJEUQKSH-UHFFFAOYSA-N
3,4-DHBA
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuate
protocatechuic acid

bigg.metabolite:34dhbz
biggM:34dhbz
envipath:...efc74746beaf
envipathM:...efc74746beaf
YQUVCSBJEUQKSH-UHFFFAOYSA-M
3,4-Dihydroxybenzoate

sabiork.compound:1983
sabiorkM:1983
kegg.compound:C00230
keggC:C00230
YQUVCSBJEUQKSH-UHFFFAOYSA-N
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
Protocatechuate
Protocatechuic acid

seed.compound:cpd28658
seedM:cpd28658
YQUVCSBJEUQKSH-UHFFFAOYSA-N
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
Pca
protocatechuate
protocatechuic acid

reactome:R-ALL-175977
reactomeM:R-ALL-175977
CHEBI:36062
chebi:36062
YQUVCSBJEUQKSH-UHFFFAOYSA-N
3,4-dihydroxybenzoic acid
3,4-Dihydroxybenzoic acid
4,5-Dihydroxybenzoic acid
4-Carboxy-1,2-dihydroxybenzene
Protocatechuic acid
Protocatehuic acid

seed.compound:cpd00197
seedM:cpd00197
YQUVCSBJEUQKSH-UHFFFAOYSA-M
Protocatechuate
3,4-DHBA
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
34dhbz
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
Pca
Protocatechuic acid
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuate
protocatechuic acid
protocatehuic acid

vmhM:34dhb
vmhmetabolite:34dhb
YQUVCSBJEUQKSH-UHFFFAOYSA-M
Protocatechuate
3,4-dihydroxybenzoic acid
hmdb:HMDB0001856
YQUVCSBJEUQKSH-UHFFFAOYSA-N
Protocatechuic acid
1,2-Dihydroxybenzene-4-carboxylic acid
2,4-Dihydroxybenzoate
2,4-Dihydroxybenzoic acid
3,4-DHBA
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
3,4-dihydroxybenzoic acid
4,5-Dihydroxybenzoate
4,5-Dihydroxybenzoic acid
4-Carboxy-1,2-dihydroxybenzene
Proto-catechuic acid
Protocatechoic acid
Protocatechuate
Protocatechuic acid, carboxy-14C-labeled
Protocatechuic acid, monosodium salt
Protocatehuate
Protocatehuic acid
b-Resorcylate
b-Resorcylic acid
beta-Resorcylate
beta-Resorcylic acid

envipath:...74b58dbfbcfc
envipathM:...74b58dbfbcfc
YQUVCSBJEUQKSH-UHFFFAOYSA-M
compound 0000136

envipath:...f0aeebfeec63
envipathM:...f0aeebfeec63
YQUVCSBJEUQKSH-UHFFFAOYSA-M
compound 0037917

metacyc.compound:3-4-DIHYDROXYBENZOATE
metacycM:3-4-DIHYDROXYBENZOATE
YQUVCSBJEUQKSH-UHFFFAOYSA-M
protocatechuate
3,4-DHBA
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
Pca
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuic acid
protocatehuic acid

hmdb:HMDB01856
chebi:11694
chebi:1380
chebi:14955
chebi:16798
chebi:19878
chebi:19879
chebi:20270
chebi:20272
chebi:41912
biggM:M_34dhbz
keggC:M_C00230
seedM:M_cpd00197
seedM:M_cpd28658
seedM:M_cpd28745
vmhM:M_34dhb
secondary/obsolete/fantasy identifier