This is version 4.2 of MetaNetX/MNXref
 Feedback

L-proline

PropertiesImageOccurences in reactions
MNX_IDMNXM114Image of MNXM114
#reac
in my sandbox 0
in MNXref (generic)257
in models (compartimentalized) 234
formulaC5H9NO2
charge0
mass115.1305
referencechebi:60039
InChIKeyONIBWKKTOPOVIA-BYPYZUCNSA-N
InChIInChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCC[NH2+]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113538
reactomeM:R-ALL-113538
reactome:R-ALL-352033
reactomeM:R-ALL-352033
reactome:R-ALL-379717
reactomeM:R-ALL-379717
CHEBI:60039
chebi:60039
L-proline
(2S)-pyrrolidinium-2-carboxylate
L-proline zwitterion
bigg.metabolite:pro__L
biggM:pro__L
L-Proline
hmdb:HMDB0000162 L-Proline
(-)-(S)-Proline
(-)-2-Pyrrolidinecarboxylate
(-)-2-Pyrrolidinecarboxylic acid
(-)-Proline
(2S)-Pyrrolidine-2-carboxylate
(2S)-Pyrrolidine-2-carboxylic acid
(2S)-pyrrolidine-2-carboxylic acid
(S)-(-)-Proline
(S)-(-)-Pyrrolidine-2-carboxylate
(S)-(-)-Pyrrolidine-2-carboxylic acid
(S)-2-Carboxypyrrolidine
(S)-2-Pyrralidinecarboxylate
(S)-2-Pyrralidinecarboxylic acid
(S)-2-Pyrrolidinecarboxylate
(S)-2-Pyrrolidinecarboxylic acid
(S)-Proline
(S)-Pyrrolidine-2-carboxylate
(S)-Pyrrolidine-2-carboxylic acid
2-Pyrrolidinecarboxylate
2-Pyrrolidinecarboxylic acid
L Proline
L-(-)-Proline
L-Prolin
L-Pyrrolidine-2-carboxylate
L-Pyrrolidine-2-carboxylic acid
L-a-Pyrrolidinecarboxylate
L-a-Pyrrolidinecarboxylic acid
L-alpha-Pyrrolidinecarboxylate
L-alpha-Pyrrolidinecarboxylic acid
L-alpha-pyrrolidinecarboxylate
L-alpha-pyrrolidinecarboxylic acid
L-proline
P
PROLINE
Prolina
Prolinum
kegg.compound:C00148
keggC:C00148
L-Proline
2-Pyrrolidinecarboxylic acid
seed.compound:cpd00129
seedM:cpd00129
L-Proline
2-Pyrrolidinecarboxylic acid
2-pyrrolidinecarboxylic acid
L-pro
L-proline
pro
pro-L
prol
proline
sabiork.compound:82
sabiorkM:82
L-Proline
2-Pyrrolidinecarboxylic acid
Pro
CHEBI:32862
chebi:32862
L-prolinate
(2S)-pyrrolidine-2-carboxylate
L-proline anion
CHEBI:17203
chebi:17203
L-proline
(-)-(S)-proline
(-)-2-pyrrolidinecarboxylic acid
(-)-proline
(2S)-pyrrolidine-2-carboxylic acid
(S)-2-carboxypyrrolidine
(S)-2-pyrrolidinecarboxylic acid
(S)-pyrrolidine-2-carboxylic acid
2-Pyrrolidinecarboxylic acid
L-(-)-proline
L-Prolin
L-Proline
L-alpha-pyrrolidinecarboxylic acid
L-pyrrolidine-2-carboxylic acid
P
PROLINE
prolina
proline
prolinum
metacyc.compound:PRO
metacycM:PRO
L-proline
2-pyrrolidinecarboxylic acid
L-pro
P
pro
prol
proline
CHEBI:32864
chebi:32864
L-prolinium
(2S)-2-carboxypyrrolidinium
L-proline cation
sabiork.compound:25536
sabiorkM:25536
kegg.compound:C16435
keggC:C16435
Proline
kegg.drug:D00035
keggD:D00035
Proline (USP)
L-Proline (JP17)
seed.compound:cpd15140
seedM:cpd15140
Proline
DL-Proline
cll_484
CHEBI:32871
chebi:32871
prolinate
pro(-)
proline anion
pyrrolidine-2-carboxylate
CHEBI:26271
chebi:26271
proline
DL-Proline
Hpro
Prolin
prolina
pyrrolidine-2-carboxylic acid
CHEBI:32872
chebi:32872
prolinium
2-carboxypyrrolidinium
H2pro(+)
proline cation
biggM:pro-L
hmdb:HMDB00162
chebi:13154
chebi:184637
chebi:21373
chebi:42067
chebi:45040
chebi:45100
chebi:45159
chebi:58054
chebi:6286
biggM:M_pro__L
keggC:M_C00148
keggC:M_C16435
keggD:M_D00035
seedM:M_cpd00129
seedM:M_cpd15140
secondary/obsolete/fantasy identifier