Feedback

7,8-diaminononanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1140Image of MNXM1140
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 7
formulaC9H21N2O2
charge1
mass189.27532
referencechebi:58500
InChIKeyKCEGBPIYGIWCDH-UHFFFAOYSA-O
InChIInChI=1S/C9H20N2O2/c1-7(10)8(11)5-3-2-4-6-9(12)13/h7-8H,2-6,10-11H2,1H3,(H,12,13)/p+1
SMILESCC([NH3+])C([NH3+])CCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58500
chebi:58500
7,8-diaminononanoate
7,8-diaminononanoate cation
7,8-diammoniononanoate
bigg.metabolite:dann
biggM:dann
sabiork.compound:5370
sabiorkM:5370
7,8-Diaminononanoate
kegg.compound:C01037
keggC:C01037
7,8-Diaminononanoate
7,8-Diaminopelargonic acid
DAPA
CHEBI:17830
chebi:17830
7,8-diaminononanoate
lipidmaps:LMFA01100062
lipidmapsM:LMFA01100062
7,8-diaminononanoic acid
7,8-DAP
7,8-DAPA
7,8-Diaminononanoate
7,8-diaminononanoic acid
7,8-diaminopelargonic acid
DAP
DAPA
CHEBI:2247
chebi:2247
7,8-diaminononanoic acid
7,8-DAP
7,8-DAPA
7,8-Diaminononanoate
7,8-diaminopelargonic acid
DAP
DAPA
metacyc.compound:DIAMINONONANOATE
metacycM:DIAMINONONANOATE
7,8-diaminopelargonate
7,8-diaminononanoate
DAPA
seed.compound:cpd00764
seedM:cpd00764
7-8-Diaminononanoate
7,8-Diaminononanoate
7,8-diaminononanoate
7,8-diaminopelargonate
DAPA
dann
chebi:12242
chebi:20765
biggM:M_dann
keggC:M_C01037
seedM:M_cpd00764
secondary/obsolete/fantasy identifier