Feedback

7,8-diaminononanoate

Properties
MNX_IDMNXM1140
formulaC9H21N2O2
charge1
mass189.27532
referencechebi:58500
Image of MNXM1140
InChIKeyKCEGBPIYGIWCDH-UHFFFAOYSA-O
InChIInChI=1S/C9H20N2O2/c1-7(10)8(11)5-3-2-4-6-9(12)13/h7-8H,2-6,10-11H2,1H3,(H,12,13)/p+1
SMILESCC([NH3+])C([NH3+])CCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
chebi:17830 7,8-diaminononanoate
seedM:cpd00764 7-8-Diaminononanoate
7,8-Diaminononanoate
7,8-diaminononanoate
7,8-diaminopelargonate
DAPA
dann
metacycM:DIAMINONONANOATE 7,8-diaminopelargonate
7,8-diaminononanoate
DAPA
lipidmaps:LMFA01100062 7,8-diaminononanoic acid
7,8-DAP
7,8-DAPA
7,8-Diaminononanoate
7,8-diaminononanoic acid
7,8-diaminopelargonic acid
DAP
DAPA
chebi:2247 7,8-diaminononanoic acid
7,8-DAP
7,8-DAPA
7,8-Diaminononanoate
7,8-diaminopelargonic acid
DAP
DAPA
keggC:C01037 7,8-Diaminononanoate
7,8-Diaminopelargonic acid
DAPA
chebi:58500 7,8-diaminononanoate
7,8-diaminononanoate cation
7,8-diammoniononanoate
biggM:dann
sabiorkM:5370
7,8-Diaminononanoate
biggM:M_dann
chebi:12242
chebi:20765
keggC:M_C01037
seedM:M_cpd00764
secondary/obsolete/fantasy identifier