Feedback

 

(2R)-2,3-dihydroxy-3-methylbutanoate

Image of MNXM114097
Properties
MNX_IDMNXM114097
formulaC5H9O4
charge-1
mass133.1231
referencechebi:49072
InChIKeyJTEYKUFKXGDTEU-VKHMYHEASA-M
InChIInChI=1S/C5H10O4/c1-5(2,9)3(6)4(7)8/h3,6,9H,1-2H3,(H,7,8)/p-1/t3-/m0/s1
SMILESCC(C)(O)[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2R)-2,3-dihydroxy-3-methylbutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:23dhmb (R)-2,3-Dihydroxy-3-methylbutanoate
chebi:10966
chebi:15684
chebi:18645
chebi:305
(2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-3-methylbutanoic acid
JTEYKUFKXGDTEU-VKHMYHEASA-N
chebi:49072 (2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-dihydroxy-3-methylbutanoate
JTEYKUFKXGDTEU-VKHMYHEASA-M
hmdb:HMDB12141 (2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-dihydroxy-isovalerate
kegg:C04272 (2R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
lipidmaps:LMFA01050453 (2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovalerate
lipidmaps:LMFA01050453
metacyc:CPD-13357 (2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate
CPD-13357
seed:cpd19030 (2R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate