Feedback

 

(S)-2-hydroxy-2-ethyl-3-oxobutanoate

Image of MNXM114220
Properties
MNX_IDMNXM114220
formulaC6H9O4
charge-1
mass145.1338
referencechebi:49256
InChIKeyVUQLHQFKACOHNZ-LURJTMIESA-M
InChIInChI=1S/C6H10O4/c1-3-6(10,4(2)7)5(8)9/h10H,3H2,1-2H3,(H,8,9)/p-1/t6-/m0/s1
SMILESCC[C@](O)(C(C)=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-2-hydroxy-2-ethyl-3-oxobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2ahbut (S)-2-Aceto-2-hydroxybutanoate
chebi:18730
chebi:27681
chebi:373
(2S)-2-ethyl-2-hydroxy-3-oxobutanoic acid
(S)-2-acetyl-2-hydroxybutanoic acid
(S)-2-acetyl-2-hydroxybutyric acid
VUQLHQFKACOHNZ-LURJTMIESA-N
chebi:49256 (2S)-2-ethyl-2-hydroxy-3-oxobutanoate
(S)-2-Aceto-2-hydroxybutanoate
(S)-2-Hydroxy-2-ethyl-3-oxobutanoate
(S)-2-acetyl-2-hydroxybutanoate
(S)-2-acetyl-2-hydroxybutyrate
(S)-2-hydroxy-2-ethyl-3-oxobutanoate
VUQLHQFKACOHNZ-LURJTMIESA-M
hmdb:HMDB06854
hmdb:HMDB06900
(2S)-2-ethyl-2-hydroxy-3-oxobutanoic acid
(S)-2-Aceto-2-hydroxybutanoic acid
lipidmaps:LMFA01050383 2S-acetyl-2-hydroxy-butanoic acid
2S-ethyl-2-hydroxy-3-oxobutanoic acid
lipidmaps:LMFA01050383
metacyc:2-ACETO-2-HYDROXY-BUTYRATE (S)-2-aceto-2-hydroxy-butyrate
(S)-2-aceto-2-hydroxybutanoate
(S)-2-hydroxy-2-ethyl-3-oxobutanoate
2-ACETO-2-HYDROXY-BUTYRATE
kegg:C06006
sabiork:2852
seed:cpd19045
(S)-2-Aceto-2-hydroxybutanoate
(S)-2-Hydroxy-2-ethyl-3-oxobutanoate