Feedback

N(2)-succinyl-L-ornithine

PropertiesImageOccurences in reactions
MNX_IDMNXM1152Image of MNXM1152
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 3
formulaC9H15N2O5
charge-1
mass231.22588
referencechebi:58514
InChIKeyVWXQFHJBQHTHMK-LURJTMIESA-M
InChIInChI=1S/C9H16N2O5/c10-5-1-2-6(9(15)16)11-7(12)3-4-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/p-1/t6-/m0/s1
SMILES[NH3+]CCC[C@H](NC(=O)CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58514
chebi:58514
N(2)-succinyl-L-ornithine
(2S)-5-ammonio-2-[(3-carboxylatopropanoyl)amino]pentanoate
N(2)-succinyl-L-ornithinate(1-)
CHEBI:27574
chebi:27574
N(2)-succinyl-L-ornithine
(2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid
N(2)-(3-carboxypropanoyl)-L-ornithine
N2-Succinyl-L-ornithine
bigg.metabolite:sucorn
biggM:sucorn
N2-Succinyl-L-ornithine
kegg.compound:C03415
keggC:C03415
N2-Succinyl-L-ornithine
(2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid
seed.compound:cpd02160
seedM:cpd02160
N2-Succinyl-L-ornithine
(2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid
N2-succinyl-L-ornithine
N2-succinylornithine
sucorn
hmdb:HMDB0001199 N2-Succinyl-L-ornithine
(2S)-5-amino-2-(3-carboxypropanamido)pentanoic acid
(2S)-5-amino-2-(3-carboxypropanoylamino)Pentanoate
(2S)-5-amino-2-(3-carboxypropanoylamino)Pentanoic acid
N(2)-Succinylornithine
N(2)-succinyl-L-ornithine
metacyc.compound:N2-SUCCINYLORNITHINE
metacycM:N2-SUCCINYLORNITHINE
N2-succinyl-L-ornithine
N2-succinylornithine
hmdb:HMDB01199
chebi:21822
chebi:45896
chebi:7375
biggM:M_sucorn
keggC:M_C03415
seedM:M_cpd02160
secondary/obsolete/fantasy identifier