Feedback

(S)-4-hydroxy-2-oxopentanoate

Properties
MNX_IDMNXM1176
formulaC5H7O4
charge-1
mass131.10668
referencechebi:73143
Image of MNXM1176
InChIKeyHFKQINMYQUXOCH-VKHMYHEASA-M
InChIInChI=1S/C5H8O4/c1-3(6)2-4(7)5(8)9/h3,6H,2H2,1H3,(H,8,9)/p-1/t3-/m0/s1
SMILESC[C@H](O)CC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd02258 4-Hydroxy-2-oxovalerate
(S)-2-oxo-4-hydroxyvalerate
(S)-2-oxo-4S-hydroxypentanoate
(S)-4-hydroxy-2-keto-pentanoic acid
(S)-4-hydroxy-2-ketovalerate
(S)-4-hydroxy-2-ketovaleric acid
(S)-4-hydroxy-2-oxo-pentanoic acid
(S)-4-hydroxy-2-oxo-valerate
(S)-4-hydroxy-2-oxo-valeric acid
(S)-4-hydroxy-2-oxopentanoate
(S)-4-hydroxy-2-oxovalerate
(S)-4-hydroxy-2-oxovaleric acid
2-oxo-4-hydroxyvalerate
2-oxo-4S-hydroxypentanoate
4-Hydroxy-2-oxopentanoate
4-hydroxy-2-keto-pentanoic acid
4-hydroxy-2-ketovalerate
4-hydroxy-2-ketovaleric acid
4-hydroxy-2-oxo-pentanoic acid
4-hydroxy-2-oxo-valerate
4-hydroxy-2-oxo-valeric acid
4-hydroxy-2-oxopentanoate
4-hydroxy-2-oxovaleric acid
4h2opntn
HKP
lipidmaps:LMFA01050466 (S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-ketovaleric acid
(4S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-oxovaleric acid
(S)-4-hydroxy-2-ketopentanoic acid
FA(5:0(OH,Ke))
envipath:...49be222a1d07 compound 37933
biggM:4h2opntn 4-Hydroxy-2-oxopentanoate
metacycM:4-HYDROXY-2-KETOVALERATE (S)-4-hydroxy-2-oxopentanoate
(S)-2-oxo-4-hydroxyvalerate
(S)-2-oxo-4S-hydroxypentanoate
(S)-4-hydroxy-2-keto-pentanoic acid
(S)-4-hydroxy-2-ketovalerate
(S)-4-hydroxy-2-ketovaleric acid
(S)-4-hydroxy-2-oxo-pentanoic acid
(S)-4-hydroxy-2-oxo-valerate
(S)-4-hydroxy-2-oxo-valeric acid
(S)-4-hydroxy-2-oxovalerate
(S)-4-hydroxy-2-oxovaleric acid
HKP
chebi:58222 4-hydroxy-2-oxopentanoate
keggC:C03589
sabiorkM:6725
4-Hydroxy-2-oxopentanoate
4-Hydroxy-2-oxovalerate
envipath:...a30a57e2a9f8 4-Hydroxy-2-oxovalerate
chebi:73143 (S)-4-hydroxy-2-oxopentanoate
(4S)-4-hydroxy-2-ketopentanoate
(4S)-4-hydroxy-2-oxopentanoate
chebi:17655 4-hydroxy-2-oxopentanoic acid
4-Hydroxy-2-oxopentanoate
4-Hydroxy-2-oxovalerate
biggM:M_4h2opntn
chebi:11994
chebi:1840
chebi:20377
keggC:M_C03589
seedM:M_cpd02258
secondary/obsolete/fantasy identifier
envipath:...973b08fa7732 compound 1116
chebi:73148 (S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-ketovaleric acid
(4S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-oxovaleric acid
(S)-4-hydroxy-2-ketopentanoic acid
MNXM146722is deprecated and replaced by this entry
MNXM723733is deprecated and replaced by this entry
MNXM723990is deprecated and replaced by this entry