Feedback

(S)-4-hydroxy-2-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1176Image of MNXM1176
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 7
formulaC5H7O4
charge-1
mass131.03498
referencechebi:73143
InChIKeyHFKQINMYQUXOCH-VKHMYHEASA-M
InChIInChI=1S/C5H8O4/c1-3(6)2-4(7)5(8)9/h3,6H,2H2,1H3,(H,8,9)/p-1/t3-/m0/s1
SMILESC[C@H](O)CC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:73143
chebi:73143
(S)-4-hydroxy-2-oxopentanoate
(4S)-4-hydroxy-2-ketopentanoate
(4S)-4-hydroxy-2-oxopentanoate
metacyc.compound:4-HYDROXY-2-KETOVALERATE
metacycM:4-HYDROXY-2-KETOVALERATE
(S)-4-hydroxy-2-oxopentanoate
(S)-2-oxo-4-hydroxyvalerate
(S)-2-oxo-4S-hydroxypentanoate
(S)-4-hydroxy-2-keto-pentanoic acid
(S)-4-hydroxy-2-ketovalerate
(S)-4-hydroxy-2-ketovaleric acid
(S)-4-hydroxy-2-oxo-pentanoic acid
(S)-4-hydroxy-2-oxo-valerate
(S)-4-hydroxy-2-oxo-valeric acid
(S)-4-hydroxy-2-oxovalerate
(S)-4-hydroxy-2-oxovaleric acid
HKP
CHEBI:73148
chebi:73148
(S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-ketovaleric acid
(4S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-oxovaleric acid
(S)-4-hydroxy-2-ketopentanoic acid
lipidmaps:LMFA01050466
lipidmapsM:LMFA01050466
(S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-ketovaleric acid
(4S)-4-hydroxy-2-oxopentanoic acid
(4S)-4-hydroxy-2-oxovaleric acid
(S)-4-hydroxy-2-ketopentanoic acid
FA 5:1
O2
bigg.metabolite:4h2opntn
biggM:4h2opntn
4-Hydroxy-2-oxopentanoate
sabiork.compound:6725
sabiorkM:6725
kegg.compound:C03589
keggC:C03589
4-Hydroxy-2-oxopentanoate
4-Hydroxy-2-oxovalerate
envipath:...a30a57e2a9f8
envipathM:...a30a57e2a9f8
4-Hydroxy-2-oxovalerate
seed.compound:cpd02258
seedM:cpd02258
4-Hydroxy-2-oxovalerate
(S)-2-oxo-4-hydroxyvalerate
(S)-2-oxo-4S-hydroxypentanoate
(S)-4-hydroxy-2-keto-pentanoic acid
(S)-4-hydroxy-2-ketovalerate
(S)-4-hydroxy-2-ketovaleric acid
(S)-4-hydroxy-2-oxo-pentanoic acid
(S)-4-hydroxy-2-oxo-valerate
(S)-4-hydroxy-2-oxo-valeric acid
(S)-4-hydroxy-2-oxopentanoate
(S)-4-hydroxy-2-oxovalerate
(S)-4-hydroxy-2-oxovaleric acid
2-oxo-4-hydroxyvalerate
2-oxo-4S-hydroxypentanoate
4-Hydroxy-2-oxopentanoate
4-hydroxy-2-keto-pentanoic acid
4-hydroxy-2-ketovalerate
4-hydroxy-2-ketovaleric acid
4-hydroxy-2-oxo-pentanoic acid
4-hydroxy-2-oxo-valerate
4-hydroxy-2-oxo-valeric acid
4-hydroxy-2-oxopentanoate
4-hydroxy-2-oxovaleric acid
4h2opntn
HKP
metacyc.compound:CPD-21382
metacycM:CPD-21382
CHEBI:58222
chebi:58222
4-hydroxy-2-oxopentanoate
CHEBI:17655
chebi:17655
4-hydroxy-2-oxopentanoic acid
4-Hydroxy-2-oxopentanoate
4-Hydroxy-2-oxovalerate
envipath:...973b08fa7732
envipathM:...973b08fa7732
compound 1116
envipath:...49be222a1d07
envipathM:...49be222a1d07
compound 37933
chebi:11994
chebi:1840
chebi:20377
biggM:M_4h2opntn
keggC:M_C03589
seedM:M_cpd02258
secondary/obsolete/fantasy identifier