Feedback

prostaglandin I2

PropertiesImageOccurences in reactions
MNX_IDMNXM1197Image of MNXM1197
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 21
formulaC20H31O5
charge-1
mass351.2177
referencechebi:57403
InChIKeyKAQKFAOMNZTLHT-OZUDYXHBSA-M
InChIInChI=1S/C20H32O5/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/h8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24)/p-1/b11-10+,15-8-/t14-,16+,17+,18+,19-/m0/s1
SMILESCCCCC[C@H](O)/C=C/[C@H]1[C@H](O)C[C@@H]2O/C(=C\CCCC(=O)[O-])C[C@@H]21
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57403
chebi:57403
prostaglandin I2
(5Z,13E,15S)-6,9alpha-epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
prostaglandin I2 anion
prostaglandin I2(1-)
kegg.drug:D00106
keggD:D00106
Epoprostenol (USAN/INN)
Epoprostenol (TN)
Prostacyclin
Prostaglandin I2
seed.compound:cpd00960
seedM:cpd00960
PGI2
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13- dienoate
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
(5z,13e)-(15s)-6,9-alpha-epoxy-11-alpha,15-dihydroxyprosta-5,13-dienoate
Epoprostenol
Prostacyclin
Prostaglandin I2
prostacyclin
prostaglandin I2
lipidmaps:LMFA03010087
lipidmapsM:LMFA03010087
PGI2
6,9S-epoxy-11R,15S-dihydroxy-5Z,13E-prostadienoic acid
FA 20:4
O3
Prostacyclin
Prostaglandin I2
bigg.metabolite:prostgi2
biggM:prostgi2
Prostaglandin I2
hmdb:HMDB0001335 Prostaglandin I2
(5Z,13E)-(15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dienoic acid
(5Z,13E)-(15S)-6,9-alpha-Epoxy-11-alpha,15-dihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-6,9-alpha-Epoxy-11-alpha,15-dihydroxyprosta-5,13-dienoic acid
(5Z,13E)-(15S)-6,9a-Epoxy-11a,15-dihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-6,9a-Epoxy-11a,15-dihydroxyprosta-5,13-dienoic acid
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoic acid
(5Z,13E)-(15S)-6,9alpha-epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
(5Z,13E)-(15S)-6,9alpha-epoxy-11alpha,15-dihydroxyprosta-5,13-dienoic acid
(5Z,13E,15S)-6,9a-Epoxy-11a,15-dihydroxyprosta-5,13-dienoate
(5Z,13E,15S)-6,9a-Epoxy-11a,15-dihydroxyprosta-5,13-dienoic acid
(5Z,9a,11a,13E,15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oate
(5Z,9a,11a,13E,15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oic acid
(5Z,9alpha,11alpha,13E,15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oate
(5Z,9alpha,11alpha,13E,15S)-6,9-Epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oic acid
(5Z,9alpha,11alpha,13E,15S)-6,9-epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oate
(5Z,9alpha,11alpha,13E,15S)-6,9-epoxy-11,15-dihydroxyprosta-5,13-dien-1-Oic acid
5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-hexahydro-2H-cyclopenta[b]furan-2-ylidene]pentanoic acid
Epoprostanol
Epoprostenol
Epoprostenol sodium
Epoprostenol sodium salt, (5Z,9alpha,11alpha,13E,15S)-isomer
Flolan
PGI2
PGX
Prostacyclin
Prostacycline
Prostaglandin I(2)
Prostaglandin X
Vasocyclin
epoprostenol
sabiork.compound:5523
sabiorkM:5523
Prostaglandin I2
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13- dienoate
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
Epoprostenol
PGI2
Prostacyclin
kegg.compound:C01312
keggC:C01312
Prostaglandin I2
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
Epoprostenol
PGI2
Prostacyclin
SLM:000390040
slm:000390040
Prostaglandin I2
PGI2
reactome:R-ALL-31593
reactomeM:R-ALL-31593
reactome:R-ALL-391926
reactomeM:R-ALL-391926
CHEBI:15552
chebi:15552
prostaglandin I2
(5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate
(5Z,13E,15S)-6,9alpha-epoxy-11alpha,15-dihydroxyprosta-5,13-dienoic acid
(5Z,9alpha,11alpha,13E,15S)-6,9-epoxy-11,15-dihydroxyprosta-5,13-dien-1-oic acid
Epoprostenol
Flolan
PGI2
PGX
Prostacyclin
Prostaglandin I2
Vasocyclin
prostaglandin X
metacyc.compound:5Z13E-15S-69-ALPHA-EPOXY-11-ALPHA
metacycM:5Z13E-15S-69-ALPHA-EPOXY-11-ALPHA
prostaglandin I2
(5z,13e)-(15s)-6,9-alpha-epoxy-11-alpha,15-dihydroxyprosta-5,13-dienoate
PGI2
prostacyclin
hmdb:HMDB01335
chebi:10912
chebi:245
chebi:26331
biggM:M_prostgi2
keggC:M_C01312
keggD:M_D00106
seedM:M_cpd00960
secondary/obsolete/fantasy identifier