Feedback

(2R,3R)-2,3-dihydroxy-3-methylpentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1202Image of MNXM1202
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 7
formulaC6H11O4
charge-1
mass147.14914
referencechebi:49258
InChIKeyPDGXJDXVGMHUIR-UJURSFKZSA-M
InChIInChI=1S/C6H12O4/c1-3-6(2,10)4(7)5(8)9/h4,7,10H,3H2,1-2H3,(H,8,9)/p-1/t4-,6+/m0/s1
SMILESCC[C@@](C)(O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49258
chebi:49258
(2R,3R)-2,3-dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-dihydroxy-3-methylvalerate
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
4,5-dideoxy-3-C-methyl-D-erythro-pentonate
CHEBI:27512
chebi:27512
(2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
(2R,3R)-2,3-dihydroxy-3-methylvaleric acid
4,5-dideoxy-3-C-methyl-D-erythro-pentonic acid
hmdb:HMDB0012140 (R) 2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoic acid
(2R,3R)-2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-Dihydroxy-3-methylvaleric acid
(2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
(R) 2,3-Dihydroxy-3-methylvaleric acid
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylpentanoic acid
(R)-2,3-Dihydroxy-3-methylvalerate
1-keto-2-Methylvalerate
2,3-Dihydroxy-3-methyl-valeric acid
2,3-Dihydroxy-3-methylpentanoate
2,3-Dihydroxy-3-methylpentanoic acid
2,3-Dihydroxy-valerianic acid
4,5-Dideoxy-3-C-methyl-pentonic acid
CID8
DMV
alpha,beta-Dihydroxy-beta-methylvaleric acid
lipidmaps:LMFA01050452
lipidmapsM:LMFA01050452
(R) 2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
FA(6:0(OH2))
bigg.metabolite:23dhmp
biggM:23dhmp
(R)-2,3-Dihydroxy-3-methylpentanoate
seed.compound:cpd19046
seedM:cpd19046
kegg.compound:C06007
keggC:C06007
(R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
metacyc.compound:1-KETO-2-METHYLVALERATE
metacycM:1-KETO-2-METHYLVALERATE
(R)-2,3-dihydroxy-3-methylpentanoate
(R)-2,3-dihydroxy-3-methylvalerate
CHEBI:882
chebi:882
kegg.compound:C04104
keggC:C04104
2,3-Dihydroxy-3-methylpentanoate
2,3-Dihydroxy-3-methylvalerate
lipidmaps:LMFA01050469
lipidmapsM:LMFA01050469
2,3-Dihydroxy-3-methylpentanoic acid
2,3-dihydroxy-3-methyl-pentanoic acid
2,3-dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylvalerate
4,5-dideoxy-3-c-methylpentonic acid
FA(6:0(OH2))
pentonic acid, 4,5-dideoxy-3-C-methyl-
seed.compound:cpd02535
seedM:cpd02535
2,3-Dihydroxy-3-methylvalerate
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
(R)-2,3-dihydroxy-3-methylpentanoate
(R)-2,3-dihydroxy-3-methylvalerate
2,3-Dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylvalerate
23dhmp
R-2-3-Dihydroxy-3-methylpentanoate
hmdb:HMDB12140
chebi:18646
chebi:306
biggM:M_23dhmp
keggC:M_C04104
keggC:M_C06007
seedM:M_cpd02535
seedM:M_cpd19046
secondary/obsolete/fantasy identifier