Feedback

(2R,3R)-2,3-dihydroxy-3-methylpentanoate

Properties
MNX_IDMNXM1202
formulaC6H11O4
charge-1
mass147.14914
referencechebi:49258
Image of MNXM1202
InChIKeyPDGXJDXVGMHUIR-UJURSFKZSA-M
InChIInChI=1S/C6H12O4/c1-3-6(2,10)4(7)5(8)9/h4,7,10H,3H2,1-2H3,(H,8,9)/p-1/t4-,6+/m0/s1
SMILESCC[C@@](C)(O)[C@@H](O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
chebi:49258 (2R,3R)-2,3-dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-dihydroxy-3-methylvalerate
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
4,5-dideoxy-3-C-methyl-D-erythro-pentonate
chebi:27512 (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
(2R,3R)-2,3-dihydroxy-3-methylvaleric acid
4,5-dideoxy-3-C-methyl-D-erythro-pentonic acid
lipidmaps:LMFA01050469 2,3-Dihydroxy-3-methylpentanoic acid
2,3-dihydroxy-3-methyl-pentanoic acid
2,3-dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylvalerate
4,5-dideoxy-3-c-methylpentonic acid
FA(6:0(OH2))
pentonic acid, 4,5-dideoxy-3-C-methyl-
metacycM:1-KETO-2-METHYLVALERATE (R)-2,3-dihydroxy-3-methylpentanoate
(R)-2,3-dihydroxy-3-methylvalerate
chebi:882
keggC:C04104
2,3-Dihydroxy-3-methylpentanoate
2,3-Dihydroxy-3-methylvalerate
hmdb:HMDB0012140 (R) 2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoic acid
(2R,3R)-2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-Dihydroxy-3-methylvaleric acid
(2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
(R) 2,3-Dihydroxy-3-methylvaleric acid
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylpentanoic acid
(R)-2,3-Dihydroxy-3-methylvalerate
1-keto-2-Methylvalerate
2,3-Dihydroxy-3-methyl-valeric acid
2,3-Dihydroxy-3-methylpentanoate
2,3-Dihydroxy-3-methylpentanoic acid
2,3-Dihydroxy-valerianic acid
4,5-Dideoxy-3-C-methyl-pentonic acid
CID8
DMV
alpha,beta-Dihydroxy-beta-methylvaleric acid
seedM:cpd02535 2,3-Dihydroxy-3-methylvalerate
(R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
(R)-2,3-dihydroxy-3-methylpentanoate
(R)-2,3-dihydroxy-3-methylvalerate
2,3-Dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylpentanoate
2,3-dihydroxy-3-methylvalerate
23dhmp
R-2-3-Dihydroxy-3-methylpentanoate
lipidmaps:LMFA01050452 (R) 2,3-Dihydroxy-3-methylvalerate
(2R,3R)-2,3-dihydroxy-3-methylpentanoic acid
FA(6:0(OH2))
biggM:23dhmp (R)-2,3-Dihydroxy-3-methylpentanoate
biggM:M_23dhmp
chebi:18646
chebi:306
hmdb:HMDB12140
keggC:M_C04104
keggC:M_C06007
seedM:M_cpd02535
seedM:M_cpd19046
secondary/obsolete/fantasy identifier
keggC:C06007
seedM:cpd19046
(R)-2,3-Dihydroxy-3-methylpentanoate
(2R,3R)-2,3-Dihydroxy-3-methylpentanoate
(R)-2,3-Dihydroxy-3-methylvalerate
MNXM162891is deprecated and replaced by this entry