Feedback

2-hydroxyglutarate

Properties
MNX_IDMNXM1210
formulaC5H6O5
charge-2
mass146.09814
referencechebi:11596
Image of MNXM1210
InChIKeyHWXBTNAVRSUOJR-UHFFFAOYSA-L
InChIInChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/p-2
SMILESOC(CCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd21873 2-HYDROXYGLUTARIC_ACID
chebi:36149 2-hydroxyglutarate(1-)
hydrogen 2-hydroxypentanedioate
metacycM:2-HYDROXYGLUTARIC_ACID 2-hydroxyglutarate
2-hydroxyglutaric acid
2-hydroxypentanedioic acid
alpha-hydroxy-glutarate
alpha-hydroxyglutarate
chebi:17084 2-hydroxyglutaric acid
2-hydroxypentanedioic acid
alpha-hydroxyglutaric acid
biggM:M_2hog
biggM:M_2hydog
chebi:1160
hmdb:HMDB59655
keggC:M_C02630
seedM:M_cpd01709
seedM:M_cpd21873
secondary/obsolete/fantasy identifier
chebi:132941 2-hydroxyglutarate
2-hydroxyglutarate anion
2-hydroxyglutaric acid anion
chebi:11596 2-hydroxyglutarate
2-hydroxyglutarate(2-)
2-hydroxypentanedioate
biggM:2hydog 2-Hydroxy-Glutarate
lipidmaps:LMFA01050483 2-hydroxyglutaric acid
2-hydroxyglutaric acid
2-oxidanylpentanedioic acid
biggM:2hog
sabiorkM:2471
2-Hydroxyglutarate
keggC:C02630
seedM:cpd01709
2-Hydroxyglutarate
alpha-Hydroxyglutarate
hmdb:HMDB0059655 2-Hydroxyglutarate
2-Hydroxyglutaric acid
2-hydroxyglutaric acid
2-hydroxypentanedioic acid
D-2-Hydroxyglutarate
a-Hydroxyglutarate
a-Hydroxyglutaric acid
alpha-Hydroxyglutarate
alpha-Hydroxyglutarate, (D)-isomer
alpha-Hydroxyglutarate, (DL)-isomer
alpha-Hydroxyglutarate, (L)-isomer
alpha-Hydroxyglutarate, disodium salt
alpha-Hydroxyglutaric acid
alpha-hydroxyglutarate
alpha-hydroxyglutaric acid