Feedback

2-oxo-2H-pyran-4,6-dicarboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1211Image of MNXM1211
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 0
formulaC7H2O6
charge-2
mass182.08718
referencechebi:58304
InChIKeyVRMXCPVFSJVVCA-UHFFFAOYSA-L
InChIInChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1cc(oc(=O)c1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58304
chebi:58304
2-oxo-2H-pyran-4,6-dicarboxylate
2-oxo-2H-pyran-4,6-dicarboxylate dianion
envipath:...964890cfd149
envipathM:...964890cfd149
kegg.compound:C03671
keggC:C03671
2-Pyrone-4,6-dicarboxylate
seed.compound:cpd02304
seedM:cpd02304
2-Pyrone-4,6-dicarboxylate
2-oxo-2H-pyran-4,6-dicarboxylate
2-pyrone-4,6-dicarboxylate
2-pyrone-4,6-dicarboxylic acid
alpha-pyrone-4,6-dicarboxylate
alpha-pyrone-4,6-dicarboxylic acid
CHEBI:17872
chebi:17872
2-oxo-2H-pyran-4,6-dicarboxylic acid
2-Pyrone-4,6-dicarboxylate
metacyc.compound:CPD-184
metacycM:CPD-184
2-pyrone-4,6-dicarboxylate
2-oxo-2H-pyran-4,6-dicarboxylate
2-pyrone-4,6-dicarboxylic acid
alpha-pyrone-4,6-dicarboxylate
alpha-pyrone-4,6-dicarboxylic acid
chebi:11655
chebi:1275
chebi:19774
keggC:M_C03671
seedM:M_cpd02304
secondary/obsolete/fantasy identifier