Feedback

 

3-mercaptopyruvate

Image of MNXM1214
Properties
MNX_IDMNXM1214
formulaC3H3O3S
charge-1
mass119.12
referencechebi:57678
InChIKeyOJOLFAIGOXZBCI-UHFFFAOYSA-M
InChIInChI=1S/C3H4O3S/c4-2(1-7)3(5)6/h7H,1H2,(H,5,6)/p-1
SMILES[O-]C(=O)C(=O)CS

This chemical compound does not exist in my selection



Occurrences of 3-mercaptopyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:mercppyr Mercaptopyruvate
chebi:57678 2-oxo-3-sulfanylpropanoate
3-mercaptopyruvate
OJOLFAIGOXZBCI-UHFFFAOYSA-M
chebi:11847
chebi:14583
chebi:16208
chebi:20103
chebi:20104
chebi:6767
2-oxo-3-sulfanylpropanoic acid
3-Mercaptopyruvate
3-Mercaptopyruvic acid
3-mercapto-2-oxopropanoic acid
3-mercaptopyruvic acid
Mercaptopyruvate
OJOLFAIGOXZBCI-UHFFFAOYSA-N
hmdb:HMDB01368 2-oxo-3-sulfanylpropanoic acid
3-Mercaptopyruvic acid
beta-mercaptopyruvic acid
kegg:C00957 3-Mercaptopyruvate
3-Mercaptopyruvic acid
Mercaptopyruvate
metacyc:3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE
3-mercaptopyruvate
3-mercaptopyruvic acid
beta-mercaptopyruvate
beta-thiopyruvate
mercaptopyruvate
sabiork:2196 3-Mercaptopyruvate
Mercaptopyruvate
seed:cpd00706 3-Mercaptopyruvate
Mercaptopyruvate
mercppyr