Feedback

2-oxo-3-sulfanylpropanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1214Image of MNXM1214
#reac
in my sandbox 0
in MNXref (generic)23
in models (compartimentalized) 10
formulaC3H3O3S
charge-1
mass118.98084
referencechebi:57678
InChIKeyOJOLFAIGOXZBCI-UHFFFAOYSA-M
InChIInChI=1S/C3H4O3S/c4-2(1-7)3(5)6/h7H,1H2,(H,5,6)/p-1
SMILESO=C([O-])C(=O)CS
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57678
chebi:57678
2-oxo-3-sulfanylpropanoate
3-mercaptopyruvate
metacyc.compound:3-MERCAPTO-PYRUVATE
metacycM:3-MERCAPTO-PYRUVATE
2-oxo-3-sulfanylpropanoate
3-mercaptopyruvate
3-mercaptopyruvic acid
beta-mercaptopyruvate
beta-thiopyruvate
mercaptopyruvate
sabiork.compound:2196
sabiorkM:2196
3-Mercaptopyruvate
Mercaptopyruvate
hmdb:HMDB0001368 3-Mercaptopyruvic acid
2-oxo-3-sulfanylpropanoic acid
3-Mercapto-2-oxopropanoate
3-Mercapto-2-oxopropanoic acid
3-Mercapto-pyruvate
3-Mercapto-pyruvic acid
3-Mercaptopyruvate
3-Mercaptopyruvate monosodium salt
Mercaptopyruvate
Mercaptopyruvic acid
Thiopyruvate
beta-3-Mercapto-2-oxo-propanoate
beta-3-Mercapto-2-oxo-propanoic acid
beta-Mercaptopyruvate
beta-Mercaptopyruvic acid
beta-Thiopyruvate
beta-Thiopyruvic acid
beta-mercaptopyruvic acid
CHEBI:16208
chebi:16208
3-mercaptopyruvic acid
2-oxo-3-sulfanylpropanoic acid
3-Mercaptopyruvate
3-Mercaptopyruvic acid
3-mercapto-2-oxopropanoic acid
Mercaptopyruvate
bigg.metabolite:mercppyr
biggM:mercppyr
Mercaptopyruvate
kegg.compound:C00957
keggC:C00957
Mercaptopyruvate
2-Oxo-3-sulfanylpropanoate
3-Mercaptopyruvate
3-Mercaptopyruvic acid
seed.compound:cpd00706
seedM:cpd00706
Mercaptopyruvate
2-oxo-3-sulfanylpropanoate
3-Mercaptopyruvate
3-Mercaptopyruvic acid
3-mercaptopyruvate
3-mercaptopyruvic acid
beta-mercaptopyruvate
beta-thiopyruvate
mercaptopyruvate
mercppyr
envipath:...bf34bbb99022
envipathM:...bf34bbb99022
compound 39592
hmdb:HMDB01368
chebi:11847
chebi:14583
chebi:20103
chebi:20104
chebi:6767
biggM:M_mercppyr
keggC:M_C00957
seedM:M_cpd00706
secondary/obsolete/fantasy identifier