Feedback

7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate

PropertiesImageOccurences in reactions
MNX_IDMNXM1219Image of MNXM1219
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 5
formulaC7H10O10P
charge-3
mass285.122061
referencechebi:58394
InChIKeyPJWIPEXIFFQAQZ-PUFIMZNGSA-K
InChIInChI=1S/C7H13O10P/c8-3(1-4(9)7(12)13)6(11)5(10)2-17-18(14,15)16/h3,5-6,8,10-11H,1-2H2,(H,12,13)(H2,14,15,16)/p-3/t3-,5-,6+/m1/s1
SMILESO[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H](O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-964909
reactomeM:R-ALL-964909
CHEBI:58394
chebi:58394
7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate
3-deoxy-7-O-phosphono-D-arabino-hept-2-ulosonate
3-deoxy-D-arabino-2-heptulosonate 7-phosphate
3-deoxy-D-erythro-hept-2-ulosonate 7-phosphate
7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate anion
7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate(1-)
bigg.metabolite:2dda7p
biggM:2dda7p
2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
sabiork.compound:1828
sabiorkM:1828
2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
2-Dahp
3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-Deoxy-D-arabino-heptulosonic acid 7-phosphate
3-Deoxy-arabino-heptulonate 7-phosphate
3-Deoxy-arabino-heptulosonate 7-phosphate
DAHP
kegg.compound:C04691
keggC:C04691
2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
2-Dahp
3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-Deoxy-D-arabino-heptulosonic acid 7-phosphate
3-Deoxy-arabino-heptulonate 7-phosphate
DAHP
metacyc.compound:3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P
metacycM:3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P
3-deoxy-D-arabino-heptulosonate 7-phosphate
2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-deoxy-D-arabino-heptulosonate-7-P
3-deoxy-arabino-heptulonate 7-phosphate
3-deoxy-arabino-heptulosonate 7-phosphate
3-deoxy-arabino-heptulosonate-7-P
DAHP
CHEBI:18150
chebi:18150
7-phospho-2-dehydro-3-deoxy-D-arabino-heptonic acid
2-Dahp
2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-Deoxy-D-arabino-heptulosonic acid 7-phosphate
3-Deoxy-arabino-heptulonate 7-phosphate
3-deoxy-7-O-phosphono-D-arabino-hept-2-ulosonic acid
3-deoxy-D-arabino-2-heptulosonic acid 7-(dihydrogen phosphate)
3-deoxy-D-arabino-heptulosonate-7-phosphate
DAHP
seed.compound:cpd02857
seedM:cpd02857
DAHP
2-Dahp
2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
2-Dehydro-3-deoxy-D-arabino-heptonate7-phosphate
2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
2dda7p
3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-Deoxy-D-arabino-heptulosonic acid 7-phosphate
3-Deoxy-arabino-heptulonate 7-phosphate
3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate
3-deoxy-D-arabino-hept-2-ulosonate-7-phosphate
3-deoxy-D-arabino-heptulosonate 7-phosphate
3-deoxy-D-arabino-heptulosonate-7-P
3-deoxy-D-arabino-heptulosonate-7-phosphate
3-deoxy-arabino-heptulonate 7-phosphate
3-deoxy-arabino-heptulosonate 7-phosphate
3-deoxy-arabino-heptulosonate-7-P
3-deoxy-d-arabino-heptulosonate-7-phosphate
chebi:1053
chebi:11544
chebi:11785
chebi:11786
chebi:19523
chebi:20003
chebi:29477
biggM:M_2dda7p
keggC:M_C04691
seedM:M_cpd02857
secondary/obsolete/fantasy identifier