Feedback

L-homocysteine

PropertiesImageOccurences in reactions
MNX_IDMNXM123Image of MNXM123
#reac
in my sandbox 0
in MNXref (generic)59
in models (compartimentalized) 32
formulaC4H9NO2S
charge0
mass135.1858
referencechebi:58199
InChIKeyFFFHZYDWPBMWHY-VKHMYHEASA-N
InChIInChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1
SMILES[NH3+][C@@H](CCS)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58199
chebi:58199
L-homocysteine
(2S)-2-azaniumyl-4-sulfanylbutanoate
L-homocysteine zwitterion
hmdb:HMDB0000742 Homocysteine
(+-)-Homocysteine
(S)-2-amino-4-mercapto-Butanoate
(S)-2-amino-4-mercapto-Butanoic acid
2 amino 4 Mercaptobutyric acid
2-amino-4-Mercaptobutyrate
2-amino-4-Mercaptobutyric acid
2-amino-4-Sulfanylbutanoate
2-amino-4-Sulfanylbutanoic acid
2-amino-4-mercapto-Butanoate
2-amino-4-mercapto-Butanoic acid
2-amino-4-mercapto-Butyric acid
2-amino-4-mercapto-DL-Butyrate
2-amino-4-mercapto-DL-Butyric acid
2-amino-4-sulfanylbutanoic acid
D,L-Homocysteine
DL-2-amino-4-Mercaptobutyric acid
DL-2-amino-4-mercapto-Butyric acid
DL-Homocysteine
DL-Homocysteine (free base)
Hcy
Homocysteine, L isomer
Homocysteine, L-isomer
L-2-amino-4-mercapto-Butyric acid
L-Homocysteine
L-Isomer homocysteine
Usaf b-12
homo-CYS
homocysteine
seed.compound:cpd19034
seedM:cpd19034
kegg.compound:C05330
keggC:C05330
Homocysteine
2-Amino-4-mercaptobutyric acid
sabiork.compound:2768
sabiorkM:2768
Homocysteine
2-Amino-4-mercaptobutyric acid
DL-Homocysteine
seed.compound:cpd00135
seedM:cpd00135
Homocysteine
L-2-Amino-4-mercaptobutyric acid
L-Homocysteine
L-homocysteine
hcys-L
homo-cys
homocysteine
bigg.metabolite:hcys__L
biggM:hcys__L
L-Homocysteine
kegg.compound:C00155
keggC:C00155
L-Homocysteine
Homocysteine
L-2-Amino-4-mercaptobutyric acid
sabiork.compound:1950
sabiorkM:1950
L-Homocysteine
L-2-Amino-4-mercaptobutyric acid
CHEBI:63072
chebi:63072
L-homocysteinate
(2S)-2-amino-4-sulfanylbutanoate
L-homocysteate
L-homocysteinate anion
L-homocysteinate(1-)
CHEBI:17588
chebi:17588
L-homocysteine
(2S)-2-amino-4-sulfanylbutanoic acid
Hcy
L-2-Amino-4-mercaptobutyric acid
L-2-amino-4-mercaptobutyric acid
L-Homocysteine
metacyc.compound:HOMO-CYS
metacycM:HOMO-CYS
L-homocysteine
homo-cys
homocysteine
CHEBI:66952
chebi:66952
homocysteinate
2-amino-4-sulfanylbutanoate
CHEBI:58065
chebi:58065
homocysteine zwitterion
2-ammonio-4-sulfanylbutanoate
2-azaniumyl-4-sulfanylbutanoate
reactome:R-ALL-174369
reactomeM:R-ALL-174369
CHEBI:17230
chebi:17230
homocysteine
2-Amino-4-mercaptobutyric acid
2-amino-4-sulfanylbutanoic acid
Hcy
Homocysteine
hmdb:HMDB0000165
hmdb:HMDB00165
hmdb:HMDB00742
chebi:13122
chebi:14408
chebi:21329
chebi:43117
chebi:5751
chebi:6245
biggM:M_hcys__L
keggC:M_C00155
keggC:M_C05330
seedM:M_cpd00135
seedM:M_cpd19034
secondary/obsolete/fantasy identifier