Feedback

formononetin

PropertiesImageOccurences in reactions
MNX_IDMNXM1232Image of MNXM1232
#reac
in my sandbox 0
in MNXref (generic)18
in models (compartimentalized) 0
formulaC16H11O4
charge-1
mass267.25614
referencechebi:77688
InChIKeyHKQYGTCOTHHOMP-UHFFFAOYSA-M
InChIInChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3/p-1
SMILESCOc1ccc(cc1)-c1coc2cc([O-])ccc2c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77688
chebi:77688
formononetin
3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-olate
formononetin(1-)
sabiork.compound:5281
sabiorkM:5281
kegg.compound:C00858
keggC:C00858
lipidmaps:LMPK12050037
lipidmapsM:LMPK12050037
Formononetin
hmdb:HMDB0005808 Formononetin
4'-O-Methyldaidzein
7-Hydroxy-3-(4-methoxyphenyl)-4-benzopyrone
7-Hydroxy-3-(4-methoxyphenyl)-4H-benzopyran-4-one
7-Hydroxy-3-(4-methoxyphenyl)-4H-benzopyran-4-one(9ci)
7-Hydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one
7-Hydroxy-4'-methoxy-isoflavone
7-Hydroxy-4'-methoxy-isoflavone (8ci)
7-Hydroxy-4'-methoxyisoflavone
7-hydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one
Biochanin b
Formononetin, 4-(14)C-labeled
Formononetol
formononetin
seed.compound:cpd00639
seedM:cpd00639
Formononetin
4'-O-methyldaidzein
7-hydroxy-4'-methoxyisoflavone
formononetin
CHEBI:18088
chebi:18088
formononetin
4'-O-methyldaidzein
7-Hydroxy-3-(4-methoxyphenyl)-4-benzopyrone
7-Hydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one
7-Hydroxy-4'-methoxyisoflavone
7-hydroxy-3-(4-methoxyphenyl)-4H-benzopyran-4-one
7-hydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one
Formononetin
biochanin B
formononetol
metacyc.compound:FORMONONETIN
metacycM:FORMONONETIN
formononetin
4'-O-methyldaidzein
7-hydroxy-4'-methoxyisoflavone
hmdb:HMDB05808
chebi:14279
chebi:18194
chebi:24086
chebi:5146
keggC:M_C00858
seedM:M_cpd00639
secondary/obsolete/fantasy identifier