Feedback

maleate

PropertiesImageOccurences in reactions
MNX_IDMNXM1239Image of MNXM1239
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 5
formulaC4H2O4
charge-2
mass113.99641
referencechebi:30780
InChIKeyVZCYOOQTPOCHFL-UPHRSURJSA-L
InChIInChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1-
SMILESO=C([O-])/C=C\C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30780
chebi:30780
maleate
(2Z)-but-2-enedioate
male
maleate(2-)
bigg.metabolite:male
biggM:male
Maleate
sabiork.compound:2278
sabiorkM:2278
Maleate
Maleic acid
cis-Butenedioic acid
seed.compound:cpd00996
seedM:cpd00996
Maleate
Maleic acid
cis-Butenedioic acid
cis-butenedioic acid
male
maleate
maleic acid
hmdb:HMDB0000176 Maleic acid
(2Z)-2-Butenedioate
(2Z)-2-Butenedioic acid
(2Z)-But-2-enedioate
(2Z)-But-2-enedioic acid
(2Z)-Butene-2-dioate
(2Z)-Butene-2-dioic acid
(2Z)-but-2-enedioic acid
(Z)-2-Butenedioate
(Z)-2-Butenedioic acid
(Z)-Butenedioate
(Z)-Butenedioic acid
2-Butenedioate
2-Butenedioic acid
H2Male
Hydrogen maleate
Kyselina maleinova
MAE
Maleate
Maleic acid, ammonium salt
Maleic acid, calcium salt
Maleic acid, dipotassium salt
Maleic acid, disodium salt
Maleic acid, iron salt
Maleic acid, monoammonium salt
Maleic acid, monocopper (2+) salt
Maleic acid, monosodium salt
Maleic acid, neodymium salt
Maleic acid, potassium salt
Maleic acid, sodium salt
Maleinic acid
Malenic acid
Malezid CM
Scotchbond multipurpose etchant
Sodium maleate
Toxilate
Toxilic acid
cis-1,2-Ethylenedicarboxylate
cis-1,2-Ethylenedicarboxylic acid
cis-2-Butenedioate
cis-2-Butenedioic acid
cis-But-2-enedioate
cis-But-2-enedioic acid
cis-Butenedioate
cis-Butenedioic acid
maleic acid
kegg.compound:C01384
keggC:C01384
Maleic acid
Maleate
cis-Butenedioic acid
envipath:...7ec3e9f93fba
envipathM:...7ec3e9f93fba
compound 42083
CHEBI:37156
chebi:37156
maleate(1-)
(2Z)-3-carboxyacrylate
(2Z)-3-carboxyprop-2-enoate
Hmale
hydrogen maleate
metacyc.compound:MALEATE
metacycM:MALEATE
maleate
cis-butenedioic acid
maleic acid
CHEBI:132951
chebi:132951
maleate
maleate anion
maleate anions
maleates
maleic acid anion
maleic acid anions
CHEBI:18300
chebi:18300
maleic acid
(2Z)-but-2-enedioic acid
(Z)-2-butenedioic acid
(Z)-butenedioic acid
H2male
MALEIC ACID
Maleic acid
cis-1,2-ethylenedicarboxylic acid
cis-Butenedioic acid
cis-but-2-enedioic acid
toxilic acid
hmdb:HMDB00176
chebi:14559
chebi:25118
chebi:25119
chebi:43836
chebi:6653
biggM:M_male
keggC:M_C01384
seedM:M_cpd00996
secondary/obsolete/fantasy identifier