Feedback

maleate

PropertiesImageOccurences in reactions
MNX_IDMNXM1239Image of MNXM1239
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 2
formulaC4H2O4
charge-2
mass114.05628
referencechebi:30780
InChIKeyVZCYOOQTPOCHFL-UPHRSURJSA-L
InChIInChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1-
SMILES[O-]C(=O)\C=C/C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30780
chebi:30780
maleate
(2Z)-but-2-enedioate
male
maleate(2-)
bigg.metabolite:male
biggM:male
Maleate
sabiork.compound:2278
sabiorkM:2278
Maleate
Maleic acid
cis-Butenedioic acid
seed.compound:cpd00996
seedM:cpd00996
Maleate
Maleic acid
cis-Butenedioic acid
cis-butenedioic acid
male
maleate
maleic acid
hmdb:HMDB0000176 Maleic acid
(2E)-2-Butenedioate
(2E)-2-Butenedioic acid
(2E)-But-2-enedioate
(2E)-But-2-enedioic acid
(2E)-but-2-enedioic acid
(e)-2-Butenedioate
(e)-2-Butenedioic acid
2-(e)-Butenedioate
2-(e)-Butenedioic acid
Allomaleate
Allomaleic acid
Ammonium fumarate
Boletate
Boletic acid
FC 33
Fumarate
Fumarsaeure
Furamag
Lichenate
Lichenic acid
Magnesium fumarate
Sodium fumarate
e297
fumaric acid
trans-1,2-Ethylenedicarboxylate
trans-1,2-Ethylenedicarboxylic acid
trans-2-Butenedioate
trans-2-Butenedioic acid
trans-But-2-enedioate
trans-But-2-enedioic acid
trans-Butenedioate
trans-Butenedioic acid
kegg.compound:C01384
keggC:C01384
Maleic acid
Maleate
cis-Butenedioic acid
envipath:...7ec3e9f93fba
envipathM:...7ec3e9f93fba
compound 42083
CHEBI:37156
chebi:37156
maleate(1-)
(2Z)-3-carboxyacrylate
(2Z)-3-carboxyprop-2-enoate
Hmale
hydrogen maleate
metacyc.compound:MALEATE
metacycM:MALEATE
maleate
cis-butenedioic acid
maleic acid
CHEBI:132951
chebi:132951
maleate
maleate anion
maleate anions
maleates
maleic acid anion
maleic acid anions
CHEBI:18300
chebi:18300
maleic acid
(2Z)-but-2-enedioic acid
(Z)-2-butenedioic acid
(Z)-butenedioic acid
H2male
MALEIC ACID
Maleic acid
cis-1,2-ethylenedicarboxylic acid
cis-Butenedioic acid
cis-but-2-enedioic acid
toxilic acid
hmdb:HMDB00176
chebi:14559
chebi:25118
chebi:25119
chebi:43836
chebi:6653
biggM:M_male
keggC:M_C01384
seedM:M_cpd00996
secondary/obsolete/fantasy identifier