Feedback

phthalate

Properties
MNX_IDMNXM1245
formulaC8H4O4
charge-2
mass164.11496
referencechebi:17563
Image of MNXM1245
InChIKeyXNGIFLGASWRNHJ-UHFFFAOYSA-L
InChIInChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1ccccc1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:17563 phthalate
1,2-benzenedicarboxylate
benzene-1,2-dicarboxylate
phthalate(2-)
sabiorkM:5692 Phthalate
1,2-Benzenedicarboxylic acid
Phthalic acid
chebi:29069 phthalic acid
1,2-Benzenedicarboxylic acid
PHTHALIC ACID
Phthalic acid
benzene-1,2-dicarboxylic acid
o-benzenedicarboxylic acid
ortho-phthalic acid
hmdb:HMDB0002107 Phthalic acid
1,2-Benzenedicarboxylate
1,2-Benzenedicarboxylic acid
Alizarinate
Alizarinic acid
M 2
Naphthalinate
Naphthalinic acid
O-Benzenedicarboxylate
O-Benzenedicarboxylic acid
O-Carboxybenzoate
O-Carboxybenzoic acid
O-Dicarboxybenzene
Phthalate
Phthalic acid, copper salt
Phthalic acid, dipotassium salt
Phthalic acid, disodium salt
Phthalic acid, monobarium salt
Phthalic acid, monocalcium salt
Phthalic acid, monoiron (2+) salt
Phthalic acid, monolead (2+) salt
Phthalic acid, monopotassium salt
Phthalic acid, monoruthenium salt
Phthalic acid, monosodium salt
Phthalic acid, potassium salt
Phthalic acid, potassium, sodium salt
Phthalic acid, sodium salt
Phthalinate
Phthalinic acid
Potassium hydrogen phthalate
Sunftal 20
benzene-1,2-dicarboxylic acid
ortho-Phthalate
ortho-Phthalic acid
phthalic acid
metacycM:PHTHALATE phthalate
1,2-benzenedicarboxylic acid
benzene-1,2-dicarboxylic acid
o-benzenedicarboxylic acid
o-dicarboxybenzene
o-phthalic acid
phthalic acid
chebi:30800 phthalate(1-)
2-carboxybenzoate
hydrogen phthalate
envipath:...9d1d6aaed103 Phthalic acid
PA;Pa (Phthalic acid)
chebi:14831
chebi:14832
chebi:26090
chebi:26093
chebi:44902
chebi:8174
hmdb:HMDB02107
keggC:M_C01606
seedM:M_cpd01129
secondary/obsolete/fantasy identifier
envipath:...c43f33dd633e compound 1479
seedM:cpd01129 Phthalate
1,2-Benzenedicarboxylic acid
1,2-benzenedicarboxylic acid
Phthalic acid
benzene-1,2-dicarboxylic acid
o-Phthalic acid
o-benzenedicarboxylic acid
o-dicarboxybenzene
o-phthalic acid
phthalate
phthalic acid
keggC:C01606 Phthalate
1,2-Benzenedicarboxylic acid
o-Phthalic acid
chebi:26092 phthalate
phthalates
envipath:...75a0ca5d9615 Phthalate
envipath:...af180d1b4e27 compound 42668
MNXM723829is deprecated and replaced by this entry
MNXM724273is deprecated and replaced by this entry
MNXM75223is deprecated and replaced by this entry