Feedback

phthalate

PropertiesImageOccurences in reactions
MNX_IDMNXM1245Image of MNXM1245
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 0
formulaC8H4O4
charge-2
mass164.01206
referencechebi:17563
InChIKeyXNGIFLGASWRNHJ-UHFFFAOYSA-L
InChIInChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2
SMILESO=C([O-])c1ccccc1C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17563
chebi:17563
phthalate
1,2-benzenedicarboxylate
benzene-1,2-dicarboxylate
phthalate(2-)
envipath:...75a0ca5d9615
envipathM:...75a0ca5d9615
Phthalate
seed.compound:cpd01129
seedM:cpd01129
Phthalate
1,2-Benzenedicarboxylic acid
1,2-benzenedicarboxylic acid
Phthalic acid
benzene-1,2-dicarboxylic acid
o-Phthalic acid
o-benzenedicarboxylic acid
o-dicarboxybenzene
o-phthalic acid
phthalate
phthalic acid
sabiork.compound:5692
sabiorkM:5692
Phthalate
1,2-Benzenedicarboxylic acid
Phthalic acid
kegg.compound:C01606
keggC:C01606
Phthalate
1,2-Benzenedicarboxylic acid
o-Phthalic acid
hmdb:HMDB0002107 Phthalic acid
1,2-Benzenedicarboxylate
1,2-Benzenedicarboxylic acid
Alizarinate
Alizarinic acid
M 2
Naphthalinate
Naphthalinic acid
O-Benzenedicarboxylate
O-Benzenedicarboxylic acid
O-Carboxybenzoate
O-Carboxybenzoic acid
O-Dicarboxybenzene
O-Phthalate
O-Phthalic acid
Ortho-phthalate
Ortho-phthalic acid
Phthalate
Phthalic acid, copper salt
Phthalic acid, dipotassium salt
Phthalic acid, disodium salt
Phthalic acid, monobarium salt
Phthalic acid, monocalcium salt
Phthalic acid, monoiron (2+) salt
Phthalic acid, monolead (2+) salt
Phthalic acid, monopotassium salt
Phthalic acid, monoruthenium salt
Phthalic acid, monosodium salt
Phthalic acid, potassium salt
Phthalic acid, potassium, sodium salt
Phthalic acid, sodium salt
Phthalinate
Phthalinic acid
Potassium hydrogen phthalate
Sunftal 20
benzene-1,2-dicarboxylic acid
phthalic acid
envipath:...9d1d6aaed103
envipathM:...9d1d6aaed103
Phthalic acid
PA;Pa (Phthalic acid)
envipath:...c43f33dd633e
envipathM:...c43f33dd633e
compound 1479
envipath:...af180d1b4e27
envipathM:...af180d1b4e27
compound 42668
CHEBI:30800
chebi:30800
phthalate(1-)
2-carboxybenzoate
hydrogen phthalate
metacyc.compound:PHTHALATE
metacycM:PHTHALATE
phthalate
1,2-benzenedicarboxylic acid
benzene-1,2-dicarboxylic acid
o-benzenedicarboxylic acid
o-dicarboxybenzene
o-phthalic acid
phthalic acid
CHEBI:26092
chebi:26092
phthalate
phthalates
CHEBI:29069
chebi:29069
phthalic acid
1,2-Benzenedicarboxylic acid
PHTHALIC ACID
Phthalic acid
benzene-1,2-dicarboxylic acid
o-benzenedicarboxylic acid
ortho-phthalic acid
hmdb:HMDB02107
chebi:14831
chebi:14832
chebi:26090
chebi:26093
chebi:44902
chebi:8174
keggC:M_C01606
seedM:M_cpd01129
secondary/obsolete/fantasy identifier