Feedback

 

(R)-S-lactoylglutathione

Image of MNXM1253
Properties
MNX_IDMNXM1253
formulaC13H20N3O8S
charge-1
mass378.379
referencechebi:57474
InChIKeyVDYDCVUWILIYQF-CSMHCCOUSA-M
InChIInChI=1S/C13H21N3O8S/c1-6(17)13(24)25-5-8(11(21)15-4-10(19)20)16-9(18)3-2-7(14)12(22)23/h6-8,17H,2-5,14H2,1H3,(H,15,21)(H,16,18)(H,19,20)(H,22,23)/p-1/t6-,7+,8+/m1/s1
SMILESC[C@@H](O)C(=O)SC[C@H](NC(=O)CC[C@H]([NH3+])C([O-])=O)C(=O)NCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (R)-S-lactoylglutathione in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:lgt__S
sabiork:3008
(R)-S-Lactoylglutathione
chebi:11014
chebi:15694
chebi:18678
chebi:355
(R)-S-Lactoylglutathione
(R)-S-lactoylglutathione
S-D-Lactoylglutathione
S-[(2R)-2-hydroxypropanoyl]-gamma-L-glutamyl-L-cysteinylglycine
S-lactoylglutathione
VDYDCVUWILIYQF-CSMHCCOUSA-N
chebi:57474 (R)-S-lactoylglutathionate anion
(R)-S-lactoylglutathionate(1-)
(R)-S-lactoylglutathione
S-[(2R)-2-hydroxypropanoyl]-gamma-L-glutamyl-L-cysteinylglycinate
VDYDCVUWILIYQF-CSMHCCOUSA-M
hmdb:HMDB01066 (2S)-2-amino-4-{[(1R)-1-[(carboxymethyl)carbamoyl]-2-{[(2R)-2-hydroxypropanoyl]sulfanyl}ethyl]carbamoyl}butanoic acid
S-Lactoylglutathione
S-lactoylglutathione
hmdb:HMDB62624 (4S)-4-amino-4-carboxy-N-[(1R)-1-(carboxymethyl-C-hydroxycarbonimidoyl)-2-{[(2R)-2-hydroxypropanoyl]sulfanyl}ethyl]butanecarboximidate
(4S)-4-amino-4-carboxy-N-[(1R)-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-{[(2R)-2-hydroxypropanoyl]sulfanyl}ethyl]butanecarboximidate
(R)-S-lactoylglutathionate(1-)
kegg:C03451 (R)-S-Lactoylglutathione
S-D-Lactoylglutathione
metacyc:S-LACTOYL-GLUTATHIONE (R)-S-lactoylglutathione
D-lactoylglutathione
S-D-lactoylglutathione
S-LACTOYL-GLUTATHIONE
reactome:5694130 (R)-S-LGSH
(R)-S-lactoylglutathione
sabiork:24624 S-Lactoylglutathione
seed:cpd02182 (R)-S-Lactoylglutathione
lgt-S