|
![]() |
InChIKey | QYOJSKGCWNAKGW-PBXRRBTRSA-K |
InChI | InChI=1S/C7H11O8P/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h2,4-6,8-9H,1H2,(H,10,11)(H2,12,13,14)/p-3/t4-,5-,6+/m1/s1 |
SMILES | O[C@@H]1CC(=C[C@@H](OP([O-])([O-])=O)[C@H]1O)C([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 4 |
Distinct compatimentalized reactions in models | 2 |
Identifier | Description |
---|---|
seedM:cpd02030 | 3-phosphoshikimate Shikimate 3-phosphate Shikimate 5-phosphate Shikimate5-phosphate shikimate 3-phosphate shikimate 5-phosphate shikimate-3-P shikimate-3-phosphate shikimate-5-P shikimate-5-phosphate skm5p |
biggM:M_skm5p chebi:11886 chebi:15084 chebi:20195 chebi:9134 keggC:M_C03175 seedM:M_cpd02030 | secondary/obsolete/fantasy identifier |
metacycM:SHIKIMATE-5P | shikimate 3-phosphate 3-phosphoshikimate shikimate 5-phosphate shikimate-3-P shikimate-5-P |
keggC:C03175 sabiorkM:1736 | Shikimate 3-phosphate Shikimate 5-phosphate |
biggM:skm5p | Shikimate 5-phosphate |
chebi:145989 | 3-phosphoshikimate 3-phosphonatoshikimate trianion 3-phosphonatoshikimate(3-) rel-(3R,4S,5R)-4,5-dihydroxy-3-(phosphonatooxy)cyclohex-1-ene-1-carboxylate |
chebi:17052 reactome:R-ALL-964859 | 3-phosphoshikimic acid Shikimate 3-phosphate Shikimate 5-phosphate rel-(3R,4S,5R)-4,5-dihydroxy-3-(phosphonooxy)cyclohex-1-ene-1-carboxylic acid |
MNXM91425 | is deprecated and replaced by this entry |
MNXM92657 | is deprecated and replaced by this entry |