Feedback

 

D-methionine

Image of MNXM1275
Properties
MNX_IDMNXM1275
formulaC5H11NO2S
charge0
mass149.211
referencechebi:57932
InChIKeyFFEARJCKVFRZRR-SCSAIBSYSA-N
InChIInChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1
SMILESCSCC[C@@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-methionine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:met__D D-Methionine
chebi:32637 (2R)-2-amino-4-(methylsulfanyl)butanoate
D-methioninate
D-methionine anion
FFEARJCKVFRZRR-SCSAIBSYSA-M
chebi:32638 (1R)-1-carboxy-3-(methylsulfanyl)propan-1-aminium
D-methionine cation
D-methioninium
FFEARJCKVFRZRR-SCSAIBSYSA-O
chebi:13005
chebi:16867
chebi:21065
chebi:4215
chebi:44071
(2R)-2-amino-4-(methylsulfanyl)butanoic acid
(R)-2-amino-4-(methylthio)butanoic acid
(R)-methionine
D-2-Amino-4-(methylthio)butyric acid
D-METHIONINE
D-Methionin
D-Methionine
D-methionine
FFEARJCKVFRZRR-SCSAIBSYSA-N
MED
chebi:57932 (2R)-2-ammonio-4-(methylsulfanyl)butanoate
(2R)-2-azaniumyl-4-(methylsulfanyl)butanoate
D-methionine
D-methionine zwitterion
FFEARJCKVFRZRR-SCSAIBSYSA-N
metacyc:CPD-218 CPD-218
D-2-amino-4-(methylthio)butyric acid
D-methionine
kegg:C00855
sabiork:2171
D-2-Amino-4-(methylthio)butyric acid
D-Methionine
seed:cpd00637 D-2-Amino-4-(methylthio)butyric acid
D-Methionine
met-D