Feedback

N-formyl-L-glutamate

Properties
MNX_IDMNXM1287
formulaC6H7NO5
charge-2
mass173.12352
referencechebi:17684
Image of MNXM1287
InChIKeyADZLWSMFHHHOBV-BYPYZUCNSA-L
InChIInChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILES[O-]C(=O)CC[C@H](NC=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
biggM:Nforglu
keggC:C01045
sabiorkM:2226
N-Formyl-L-glutamate
metacycM:CPD-600 N-formyl-L-glutamate
formyl-glu
formylglutamate
chebi:48309 N-formyl-L-glutamic acid
(2S)-2-(formylamino)pentanedioic acid
(2S)-2-formamidopentanedioic acid
N-Formyl-L-glutamate
N-Formyl-L-glutamic acid
hmdb:HMDB0003470 N-Formyl-L-glutamic acid
(2S)-2-(formylamino)Pentanedioate
(2S)-2-(formylamino)Pentanedioic acid
(2S)-2-Formamidopentanedioate
(2S)-2-Formamidopentanedioic acid
(2S)-2-formamidopentanedioic acid
N-Formyl-L-glutamate
N-Formylglutamate
N-Formylglutamate, ion(2-)
N-formyl-L-glutamic acid
seedM:cpd24605 N-formyl-L-glutamate
chebi:17684 N-formyl-L-glutamate
(2S)-2-(formylamino)pentanedioate
(2S)-2-formamidopentanedioate
N-formyl-L-glutamate(2-)
seedM:cpd00770 N-Formyl-L-glutamate
Nforglu
formyl-glu
formylglutamate
biggM:M_Nforglu
chebi:12504
chebi:21710
chebi:21711
chebi:7278
hmdb:HMDB03470
keggC:M_C01045
seedM:M_cpd00770
seedM:M_cpd24605
secondary/obsolete/fantasy identifier