Feedback

N-formyl-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM1287Image of MNXM1287
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 3
formulaC6H7NO5
charge-2
mass173.12352
referencechebi:17684
InChIKeyADZLWSMFHHHOBV-BYPYZUCNSA-L
InChIInChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILES[O-]C(=O)CC[C@H](NC=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17684
chebi:17684
N-formyl-L-glutamate
(2S)-2-(formylamino)pentanedioate
(2S)-2-formamidopentanedioate
N-formyl-L-glutamate(2-)
bigg.metabolite:Nforglu
biggM:Nforglu
sabiork.compound:2226
sabiorkM:2226
kegg.compound:C01045
keggC:C01045
N-Formyl-L-glutamate
seed.compound:cpd00770
seedM:cpd00770
N-Formyl-L-glutamate
Nforglu
formyl-glu
formylglutamate
hmdb:HMDB0003470 N-Formyl-L-glutamic acid
(2S)-2-(formylamino)Pentanedioate
(2S)-2-(formylamino)Pentanedioic acid
(2S)-2-Formamidopentanedioate
(2S)-2-Formamidopentanedioic acid
(2S)-2-formamidopentanedioic acid
N-Formyl-L-glutamate
N-Formylglutamate
N-Formylglutamate, ion(2-)
N-formyl-L-glutamic acid
seed.compound:cpd24605
seedM:cpd24605
N-formyl-L-glutamate
metacyc.compound:CPD-600
metacycM:CPD-600
N-formyl-L-glutamate
formyl-glu
formylglutamate
CHEBI:48309
chebi:48309
N-formyl-L-glutamic acid
(2S)-2-(formylamino)pentanedioic acid
(2S)-2-formamidopentanedioic acid
N-Formyl-L-glutamate
N-Formyl-L-glutamic acid
hmdb:HMDB03470
chebi:12504
chebi:21710
chebi:21711
chebi:7278
biggM:M_Nforglu
keggC:M_C01045
seedM:M_cpd00770
seedM:M_cpd24605
secondary/obsolete/fantasy identifier