Feedback

oxalosuccinate

Properties
MNX_IDMNXM1289
formulaC6H3O7
charge-3
mass187.08382
referencechebi:58931
Image of MNXM1289
InChIKeyUFSCUAXLTRFIDC-UHFFFAOYSA-K
InChIInChI=1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3
SMILES[O-]C(=O)CC(C([O-])=O)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
chebi:7815 oxalosuccinic acid
1-oxopropane-1,2,3-tricarboxylate
1-oxopropane-1,2,3-tricarboxylic acid
Oxalbernsteinsaeure
Oxalosuccinate
Oxalosuccinic acid
metacycM:OXALO-SUCCINATE oxalosuccinate
oxalo-succ
biggM:M_HC01434
hmdb:HMDB03974
keggC:M_C05379
seedM:M_cpd03187
secondary/obsolete/fantasy identifier
keggC:C05379
sabiorkM:2782
Oxalosuccinate
Oxalosuccinic acid
biggM:HC01434 Oxalatosuccinate(3-)
chebi:58931 oxalosuccinate
1-oxopropane-1,2,3-tricarboxylate
oxalatosuccinate(3-)
hmdb:HMDB0003974 Oxalosuccinic acid
1-Oxopropane-1,2,3-tricarboxylate
1-Oxopropane-1,2,3-tricarboxylic acid
1-oxopropane-1,2,3-tricarboxylic acid
Oxalbernsteinsaeure
Oxalosuccinate
oxalosuccinate
seedM:cpd03187 Oxalosuccinate
Oxalosuccinic acid
oxalo-succ
oxalosuccinate
oxasucc