Feedback

4-guanidinobutanoate

Properties
MNX_IDMNXM1312
formulaC5H11N3O2
charge0
mass145.15986
referencechebi:57486
Image of MNXM1312
InChIKeyTUHVEAJXIMEOSA-UHFFFAOYSA-N
InChIInChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8)
SMILESNC(=[NH2+])NCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:86392 4-guanidinobutanoate
4-carbamimidamidobutanoate
seedM:cpd00762 4-Guanidinobutanoate
4-Guanidinobutyric acid
4-guanidinobutanoate
4-guanidinobutyrate
4-guanido-butyrate
4gubut
gamma-guanidinobutyrate
chebi:15728 4-guanidinobutanoic acid
4-(carbamimidamido)butanoic acid
4-Guanidinobutanoate
4-Guanidinobutyric acid
gamma-Guanidinobutyrate
gamma-Guanidinobutyric acid
chebi:86564 4-guanidinobutyric acid
4-(diaminomethylideneamino)butanoic acid
4-carbamimidamidobutanoic acid
4-guanidinobutanoic acid
keggC:C01035 4-Guanidinobutanoate
4-Guanidinobutyric acid
biggM:4gudbutn 4 Guanidinobutanoate
biggM:M_4gudbutn
chebi:11991
chebi:1834
chebi:20372
hmdb:HMDB0005991
hmdb:HMDB03464
hmdb:HMDB05991
keggC:M_C01035
seedM:M_cpd00762
secondary/obsolete/fantasy identifier
sabiorkM:5368 4-Guanidinobutanoate
chebi:57486 4-guanidinobutanoate
4-guanidinobutanoic acid zwitterion
4-{[amino(iminio)methyl]amino}butanoate
metacycM:CPD-592 4-guanidinobutanoate
4-guanidinobutyrate
4-guanido-butyrate
gamma-guanidinobutyrate
hmdb:HMDB0003464 4-Guanidinobutanoic acid
4-(carbamimidamido)Butanoate
4-(carbamimidamido)Butanoic acid
4-Guanidinobutanoate
4-Guanidinobutyrate
4-Guanidinobutyric acid
4-[(diaminomethylidene)amino]butanoic acid
g-Guanidinobutyrate
g-Guanidinobutyric acid
gamma-Guanidinobutyrate
gamma-Guanidinobutyrate, monosodium salt
gamma-Guanidinobutyric acid
gamma-guanidinobutyrate
gamma-guanidinobutyric acid