Feedback

O-phospho-L-homoserine

PropertiesImageOccurences in reactions
MNX_IDMNXM1334Image of MNXM1334
#reac
in my sandbox 0
in MNXref (generic)13
in models (compartimentalized) 8
formulaC4H8NO6P
charge-2
mass197.083221
referencechebi:57590
InChIKeyFXDNYOANAXWZHG-VKHMYHEASA-L
InChIInChI=1S/C4H10NO6P/c5-3(4(6)7)1-2-11-12(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/p-2/t3-/m0/s1
SMILES[NH3+][C@@H](CCOP([O-])([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57590
chebi:57590
O-phospho-L-homoserine
(2S)-2-azaniumyl-4-(phosphonatooxy)butanoate
O-phosphonato-L-homoserine(2-)
bigg.metabolite:phom
biggM:phom
kegg.compound:C01102
keggC:C01102
O-Phospho-L-homoserine
seed.compound:cpd00809
seedM:cpd00809
O-Phospho-L-homoserine
O-phospho-L-homoserine
o-phosphohomoserine
phom
sabiork.compound:2246
sabiorkM:2246
O-Phospho-L-homoserine
OPH
hmdb:HMDB0003484 O-Phosphohomoserine
(2S)-2-amino-4-(phosphonooxy)butanoic acid
2-amino-4-Hydroxy-butyric acid phosphate
Homoserine phosphate
Homoserine phosphoric acid
L-2-amino-4-Hydroxy-butyric acid dihydrogen phosphate (ester)
L-Homoserine, dihydrogen phosphate (ester)
L-Homoserine, dihydrogen phosphoric acid (ester)
O-Phosphohomoserine, (DL)-isomer
O-phospho-Homoserine
O-phospho-L-Homoserine
O-phosphohomoserine
seed.compound:cpd12751
seedM:cpd12751
kegg.compound:C05702
keggC:C05702
O-Phosphorylhomoserine
CHEBI:15961
chebi:15961
O-phospho-L-homoserine
(2S)-2-amino-4-(phosphonooxy)butanoic acid
Homoserine phosphate
L-Homoserine, dihydrogen phosphate (ester)
O-Phospho-L-homoserine
O-Phosphohomoserine
metacyc.compound:O-PHOSPHO-L-HOMOSERINE
metacycM:O-PHOSPHO-L-HOMOSERINE
O-phospho-L-homoserine
o-phosphohomoserine
hmdb:HMDB0062692 O-phosphonato-L-homoserine(2-)
2-amino-4-(phosphonooxy)butanoic acid
Homoserine phosphate
O-Phosphohomoserine
O-Phosphohomoserine, (DL)-isomer
O-phosphorylhomoserine
CHEBI:21969
chebi:21969
O-phosphorylhomoserine
O-Phosphorylhomoserine
O-phosphorylhomoserines
hmdb:HMDB0006495
hmdb:HMDB03484
hmdb:HMDB06495
hmdb:HMDB62692
chebi:12693
chebi:12717
chebi:21965
chebi:7691
chebi:7697
biggM:M_phom
keggC:M_C01102
keggC:M_C05702
seedM:M_cpd00809
seedM:M_cpd12751
secondary/obsolete/fantasy identifier