Feedback

2-oxopropyl-coenzyme M

PropertiesImageOccurences in reactions
MNX_IDMNXM1358Image of MNXM1358
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC5H9O4S2
charge-1
mass197.25456
referencechebi:57552
InChIKeyCRNXHFXAXBWIRH-UHFFFAOYSA-M
InChIInChI=1S/C5H10O4S2/c1-5(6)4-10-2-3-11(7,8)9/h2-4H2,1H3,(H,7,8,9)/p-1
SMILESCC(=O)CSCCS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57552
chebi:57552
2-oxopropyl-coenzyme M
2-[(2-oxopropyl)sulfanyl]ethane-1-sulfonate
2-[(2-oxopropyl)sulfanyl]ethanesulfonate
2-oxopropyl-CoM anion
2-oxopropyl-CoM(1-)
2-oxopropyl-coenzyme M(1-)
envipath:...9b927cc40d4b
envipathM:...9b927cc40d4b
2-Oxopropyl-CoM
kegg.compound:C11497
keggC:C11497
2-Oxopropyl-CoM
2-(2-Oxopropylthio)ethanesulfonate
seed.compound:cpd08336
seedM:cpd08336
2-Oxopropyl-CoM
2-(2-Oxopropylthio)ethanesulfonate
2-oxopropyl-CoM
metacyc.compound:2-OXOPROPYL-COM
metacycM:2-OXOPROPYL-COM
2-oxopropyl-CoM
CHEBI:15881
chebi:15881
2-oxopropyl-CoM
2-(2-Oxopropylthio)ethanesulfonate
2-Oxopropyl-CoM
2-[(2-oxopropyl)sulfanyl]ethanesulfonic acid
2-ketopropyl-CoM
chebi:11463
chebi:11644
chebi:1259
chebi:19759
keggC:M_C11497
seedM:M_cpd08336
secondary/obsolete/fantasy identifier