Feedback

D-tryptophan

PropertiesImageOccurences in reactions
MNX_IDMNXM1373Image of MNXM1373
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 0
formulaC11H12N2O2
charge0
mass204.22526
referencechebi:57719
InChIKeyQIVBCDIJIAJPQS-SECBINFHSA-N
InChIInChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1
SMILES[NH3+][C@H](Cc1c[nH]c2ccccc12)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57719
chebi:57719
D-tryptophan
(2R)-2-ammonio-3-(1H-indol-3-yl)propanoate
(2R)-2-azaniumyl-3-(1H-indol-3-yl)propanoate
D-tryptophan zwitterion
tryptophan
sabiork.compound:2073
sabiorkM:2073
kegg.compound:C00525
keggC:C00525
D-Tryptophan
hmdb:HMDB0013609 D-Tryptophan
(+)-Tryptophan
(2R)-2-amino-3-(1H-indol-3-yl)Propanoate
(2R)-2-amino-3-(1H-indol-3-yl)Propanoic acid
(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid
(R)-(+)-2-amino-3-(3-Indolyl)propionic acid
(R)-2-amino-3-(3-Indolyl)propionic acid
(R)-Tryptophan
D-(+)-Tryptophan
D-Tryptophane
D-Trytophane
D-alpha-amino-3-Indolepropionic acid
D-tryptophan
DL-Tryptophan
DTR
H-D-TRP-OH
H-delta-TRP-OH
Tryptophan
delta-(+)-Tryptophan
delta-Tryptophane
delta-Trytophane
delta-alpha-amino-3-Indolepropionic acid
seed.compound:cpd00411
seedM:cpd00411
D-Tryptophan
D-tryptophan
metacyc.compound:D-TRYPTOPHAN
metacycM:D-TRYPTOPHAN
D-tryptophan
CHEBI:32716
chebi:32716
D-tryptophanate
(2R)-2-amino-3-(1H-indol-3-yl)propanoate
D-tryptophan anion
CHEBI:32717
chebi:32717
D-tryptophanium
(1R)-1-carboxy-2-(1H-indol-3-yl)ethanaminium
D-tryptophan cation
reactome:R-ALL-444605
reactomeM:R-ALL-444605
CHEBI:16296
chebi:16296
D-tryptophan
(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid
(R)-tryptophan
D-TRYPTOPHAN
D-Tryptophan
DTR
hmdb:HMDB13609
chebi:13028
chebi:21110
chebi:42157
chebi:42206
chebi:42235
chebi:42297
chebi:4257
keggC:M_C00525
seedM:M_cpd00411
secondary/obsolete/fantasy identifier