Feedback

12-Epideoxycholic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM1374Image of MNXM1374
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC24H39O4
charge-1
mass391.56406
referencechebi:81242
InChIKeyKXGVEGMKQFWNSR-MFSKYVBHSA-M
InChIInChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/p-1/t14-,15-,16-,17+,18-,19+,20+,21-,23+,24-/m1/s1
SMILESC[C@H](CCC([O-])=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@@H](O)[C@]12C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:81242
chebi:81242
kegg.compound:C17646
keggC:C17646
12-Epideoxycholic acid
12-Epideoxycholate
seed.compound:cpd17762
seedM:cpd17762
12-Epideoxycholate
12-Epideoxycholic acid
hmdb:HMDB0000411 3a,12b-Dihydroxy-5b-cholanoic acid
(4R)-4-[(1S,2S,5R,7R,10R,11S,14R,15R,16R)-5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]pentanoic acid
12-Epi-deoxy-cholate
12-Epi-deoxy-cholic acid
12-Epi-deoxycholate
12-Epi-deoxycholic acid
12-Epideoxycholate
12-Epideoxycholic acid
12-epideoxycholate
3a,12b-Dihydroxy-5b-cholan-24-Oate
3a,12b-Dihydroxy-5b-cholan-24-Oic acid
3a,12b-Dihydroxy-5b-cholanate
3a,12b-Dihydroxy-5b-cholanic acid
3a,12b-Dihydroxy-5b-cholanoate
3a,12b-Dihydroxycholanoate
3a,12b-Dihydroxycholanoic acid
lipidmaps:LMST04010041
lipidmapsM:LMST04010041
Lagodeoxycholic
3alpha,12beta-Dihydroxy-5beta-cholan-24-oic Acid
hmdb:HMDB00411
keggC:M_C17646
seedM:M_cpd17762
secondary/obsolete/fantasy identifier