Feedback

 

5-formyltetrahydrofolate

Image of MNXM1392
Properties
MNX_IDMNXM1392
formulaC20H21N7O7
charge-2
mass471.4245
referencechebi:57457
InChIKeyVVIAGPKUTFNRDU-STQMWFEESA-L
InChIInChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/p-2/t12-,13-/m0/s1
SMILES[H]C(=O)N1[C@@H](CNc2ccc(cc2)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)CNc2[nH]c(N)nc(=O)c12

This chemical compound does not exist in my selection



Occurrences of 5-formyltetrahydrofolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:5fthf 5-Formyltetrahydrofolate
chebi:12127
chebi:15640
chebi:18607
chebi:2057
(5-formyl-5,6,7,8-tetrahydropteroyl)glutamate
10-Formyl-7,8-dihydrofolic acid
5-Formyl-5,6,7,8-tetrahydrofolic acid
5-Formyl-5,6,7,8-tetrahydropteroyl-L-glutamic acid
5-Formyltetrahydrofolate
5-formyltetrahydrofolic acid
Acide folinique
Folinic acid
L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid
Leucovorin
Leucovorinum
N-(5-formyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid
N-[4-({[2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
N5-Formyl-5,6,7,8-tetrahydrofolic acid
N5-Formyltetrahydrofolic acid
VVIAGPKUTFNRDU-ABLWVSNPSA-N
folinate
chebi:57457 (6S)-5-formyltetrahydrofolate(2-)
5-formyltetrahydrofolate
5-formyltetrahydrofolate dianion
N-[4-({[(6S)-2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamate
VVIAGPKUTFNRDU-STQMWFEESA-L
chebi:63606 (6S)-5-Formyl-5,6,7,8-tetrahydrofolic acid
(6S)-5-formyltetrahydrofolic acid
(6S)-Folinic acid
(6S)-Leucovorin
(S)-Leucovorin
Citrovorum factor
L-Folinic acid
Levofolene
Levofolinic acid
N-[4-({[(6S)-2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
N-[4-({[(6S)-2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
VVIAGPKUTFNRDU-STQMWFEESA-N
levoleucovorin
chebi:65340 (2S)-2-[(4-{[(2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl)amino]pentanedioate
5-formyltetrahydrofolate(2-)
VVIAGPKUTFNRDU-ABLWVSNPSA-L
hmdb:HMDB01562
hmdb:HMDB06206
2-[(4-{[(2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
2-[(4-{[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
Folinic acid
hmdb:HMDB62757 (4S)-4-carboxy-4-{[4-({[(6S)-5-formyl-2-imino-4-oxido-1,2,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}butanoate
(4S)-4-carboxy-4-{[4-({[(6S)-5-formyl-2-imino-4-oxido-1,6,7,8-tetrahydropteridin-6-yl]methyl}amino)phenyl]formamido}butanoate
(6S)-5-formyltetrahydrofolate(2-)
kegg:C03479
kegg:D07986
5-Formyltetrahydrofolate
Folinic acid
Folinic acid (BAN)
L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid
Leucovorin
Rescuvolin (TN)
metacyc:5-FORMYL-THF (6S)-5-formyl-tetrahydrofolate mono-L-glutamate
(6S)-leucovorin
5-CHO-THF monoglutamate
5-FORMYL-THF
5-formyl-H4F monoglutamate
5-formyl-THF monoglutamate
N5-formyl-H4F monoglutamate
N5-formyl-H4PteGlu1
N5-formyl-THF monoglutamate
citrovorum factor
folinate
folinic acid monoglutamate
formyl-H4F monoglutamate
n5-formyl-thf monoglutamate
n5-formyltetrahydrofolate monoglutamate
sabiork:6654 5-Formyltetrahydrofolate
Folinic acid
L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid
seed:cpd02197 5-Formyltetrahydrofolate
5fthf
Folinic acid
L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid
deprecated:MNXM38124
deprecated:MNXM97033