Feedback

1-chloro-2,4-dinitrobenzene

PropertiesImageOccurences in reactions
MNX_IDMNXM1398Image of MNXM1398
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC6H3ClN2O4
charge0
mass202.5518
referencechebi:34718
InChIKeyVYZAHLCBVHPDDF-UHFFFAOYSA-N
InChIInChI=1S/C6H3ClN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H
SMILES[O-][N+](=O)c1ccc(Cl)c(c1)[N+]([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-176044
reactomeM:R-ALL-176044
CHEBI:34718
chebi:34718
1-chloro-2,4-dinitrobenzene
1,3-Dinitro-4-chlorobenzene
1-Chloro-2,4-dinitrobenzene
1-Chloro-2,4-dinitrobenzol
2,4-Dinitro-1-chlorobenzene
2,4-Dinitrochlorobenzene
2,4-Dinitrophenyl chloride
4-Chloro-1,3-dinitrobenzene
6-Chloro-1,3-dinitrobenzene
Cdnb
Chlorodinitrobenzene
ClDNB
DNCB
DNPCl
Dinitrochlorobenzene
Dncb
sabiork.compound:18763
sabiorkM:18763
1-Chloro-2,4-dinitrobenzene
CDNB
metacyc.compound:1-CHLORO-24-DINITROBENZENE
metacycM:1-CHLORO-24-DINITROBENZENE
1-chloro-2,4-dinitrobenzene
CDNB
kegg.compound:C14397
keggC:C14397
Dinitrochlorobenzene
1-Chloro-2,4-dinitrobenzene
seed.compound:cpd10096
seedM:cpd10096
Dinitrochlorobenzene
1-Chloro-2,4-dinitrobenzene
1-chloro-2,4-dinitrobenzene
CDNB
keggC:M_C14397
seedM:M_cpd10096
secondary/obsolete/fantasy identifier