Feedback

L-leucine

PropertiesImageOccurences in reactions
MNX_IDMNXM140Image of MNXM140
#reac
in my sandbox 0
in MNXref (generic)271
in models (compartimentalized) 235
formulaC6H13NO2
charge0
mass131.17296
referencechebi:57427
InChIKeyROHFNLRQFUQHCH-YFKPBYRVSA-N
InChIInChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1
SMILESCC(C)C[C@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113580
reactomeM:R-ALL-113580
reactome:R-ALL-29588
reactomeM:R-ALL-29588
reactome:R-ALL-351964
reactomeM:R-ALL-351964
CHEBI:57427
chebi:57427
L-leucine
(2S)-2-azaniumyl-4-methylpentanoate
L-leucine zwitterion
leucine zwitterion
lipidmaps:LMFA01100048
lipidmapsM:LMFA01100048
2-Amino-4-methylpentanoic acid
2-Amino-4-methylpentanoic acid
hmdb:HMDB0062203 3,3,5-triiodo-L-thyronine-beta-D-glucuronoside
(2S)-2-amino-4-Methylpentanoate
(2S)-2-amino-4-Methylpentanoic acid
(2S)-2-amino-4-methylpentanoic acid
(2S)-a-2-amino-4-Methylvalerate
(2S)-a-2-amino-4-Methylvaleric acid
(2S)-a-Leucine
(2S)-alpha-2-amino-4-Methylvalerate
(2S)-alpha-2-amino-4-Methylvaleric acid
(2S)-alpha-2-amino-4-methylvalerate
(2S)-alpha-2-amino-4-methylvaleric acid
(2S)-alpha-Leucine
(2S)-alpha-leucine
(S)-(+)-Leucine
(S)-2-amino-4-Methylpentanoate
(S)-2-amino-4-Methylpentanoic acid
(S)-2-amino-4-Methylvalerate
(S)-2-amino-4-Methylvaleric acid
(S)-Leucine
2-amino-4-Methylvalerate
2-amino-4-Methylvaleric acid
4-Methyl-L-norvaline
L
L-(+)-Leucine
L-Isomer leucine
L-Leucin
L-Leuzin
L-a-Aminoisocaproate
L-a-Aminoisocaproic acid
L-alpha-Aminoisocaproate
L-alpha-Aminoisocaproic acid
L-leucine
LEUCINE
Leu
Leucine, L isomer
Leucine, L-isomer
bigg.metabolite:leu__L
biggM:leu__L
L-Leucine
hmdb:HMDB0000687 L-Leucine
(2S)-2-amino-4-Methylpentanoate
(2S)-2-amino-4-Methylpentanoic acid
(2S)-2-amino-4-methylpentanoic acid
(2S)-a-2-amino-4-Methylvalerate
(2S)-a-2-amino-4-Methylvaleric acid
(2S)-a-Leucine
(2S)-alpha-2-amino-4-Methylvalerate
(2S)-alpha-2-amino-4-Methylvaleric acid
(2S)-alpha-2-amino-4-methylvalerate
(2S)-alpha-2-amino-4-methylvaleric acid
(2S)-alpha-Leucine
(2S)-alpha-leucine
(S)-(+)-Leucine
(S)-2-amino-4-Methylpentanoate
(S)-2-amino-4-Methylpentanoic acid
(S)-2-amino-4-Methylvalerate
(S)-2-amino-4-Methylvaleric acid
(S)-Leucine
2-amino-4-Methylvalerate
2-amino-4-Methylvaleric acid
4-Methyl-L-norvaline
L
L-(+)-Leucine
L-Isomer leucine
L-Leucin
L-Leuzin
L-a-Aminoisocaproate
L-a-Aminoisocaproic acid
L-alpha-Aminoisocaproate
L-alpha-Aminoisocaproic acid
L-leucine
LEUCINE
Leu
Leucine, L isomer
Leucine, L-isomer
seed.compound:cpd00107
seedM:cpd00107
L-Leucine
(2S)-alpha-2-Amino-4-methylvaleric acid
(2S)-alpha-2-amino-4-methylvaleric acid
(2S)-alpha-Leucine
(2S)-alpha-leucine
2-Amino-4-methylvaleric acid
2-amino-4-methylvaleric acid
L-leu
L-leucine
leu
leu-L
leucine
kegg.compound:C00123
keggC:C00123
L-Leucine
(2S)-alpha-2-Amino-4-methylvaleric acid
(2S)-alpha-Leucine
2-Amino-4-methylvaleric acid
sabiork.compound:69
sabiorkM:69
L-Leucine
(2S)-alpha-2-Amino-4-methylvaleric acid
(2S)-alpha-Leucine
2-Amino-4-methylvaleric acid
Leu
CHEBI:32619
chebi:32619
L-leucinate
(2S)-2-amino-4-methylpentanoate
L-leucine anion
CHEBI:15603
chebi:15603
L-leucine
(2S)-2-amino-4-methylpentanoic acid
(2S)-alpha-2-Amino-4-methylvaleric acid
(2S)-alpha-Leucine
(S)-(+)-leucine
(S)-leucine
2-Amino-4-methylvaleric acid
L
L-Leucin
L-Leucine
L-Leuzin
LEUCINE
Leu
metacyc.compound:LEU
metacycM:LEU
L-leucine
(2S)-alpha-2-amino-4-methylvaleric acid
(2S)-alpha-leucine
2-amino-4-methylvaleric acid
L
L-leu
leu
leucine
CHEBI:32620
chebi:32620
L-leucinium
(1S)-1-carboxy-3-methylbutan-1-aminium
L-leucine cation
sabiork.compound:21059
sabiorkM:21059
kegg.compound:C16439
keggC:C16439
Leucine
kegg.drug:D00030
keggD:D00030
Leucine (USP)
L-Leucine (JP17)
seed.compound:cpd15143
seedM:cpd15143
Leucine
cll_94
CHEBI:32627
chebi:32627
leucinate
2-amino-4-methylpentanoate
leu(-)
leucine anion
CHEBI:25017
chebi:25017
leucine
(+-)-Leucine
(RS)-Leucine
2-amino-4-methylpentanoic acid
DL-Leucine
Hleu
L
Leu
Leucin
Leuzin
CHEBI:32628
chebi:32628
leucinium
1-carboxy-3-methylbutan-1-aminium
H2leu(+)
leucine cation
biggM:leu-L
hmdb:HMDB00687
hmdb:HMDB62203
chebi:10866
chebi:13131
chebi:21348
chebi:43646
chebi:43695
chebi:43733
chebi:43814
chebi:6260
biggM:M_leu__L
keggC:M_C00123
keggC:M_C16439
keggD:M_D00030
seedM:M_cpd00107
seedM:M_cpd15143
secondary/obsolete/fantasy identifier