Feedback

3,4-dihydroxyphenylacetaldehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM1401Image of MNXM1401
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 10
formulaC8H8O3
charge0
mass152.04734
referencechebi:27978
InChIKeyIADQVXRMSNIUEL-UHFFFAOYSA-N
InChIInChI=1S/C8H8O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,4-5,10-11H,3H2
SMILESO=CCc1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:27978
chebi:27978
3,4-dihydroxyphenylacetaldehyde
(3,4-dihydroxyphenyl)acetaldehyde
2-(3,4-dihydroxyphenyl)ethanal
3,4-Dihydroxyphenylacetaldehyde
DOPAL
Protocatechuatealdehyde
bigg.metabolite:34dhpac
biggM:34dhpac
3,4-Dihydroxyphenylacetaldehyde
hmdb:HMDB0003791 3,4-Dihydroxyphenylacetaldehyde
2-(3,4-Dihydroxyphenyl)ethanal
2-(3,4-dihydroxyphenyl)acetaldehyde
3,4-Dihydroxy-benzeneacetaldehyde
DHPAA aldehyde
DOPAL
Protocatechuatealdehyde
dopal
sabiork.compound:7037
sabiorkM:7037
kegg.compound:C04043
keggC:C04043
3,4-Dihydroxyphenylacetaldehyde
Protocatechuatealdehyde
metacyc.compound:34-DIHYDROXYPHENYLACETALDEHYDE
metacycM:34-DIHYDROXYPHENYLACETALDEHYDE
3,4-dihydroxyphenylacetaldehyde
protocatechuatealdehyde
seed.compound:cpd02500
seedM:cpd02500
Protocatechuatealdehyde
3,4-Dihydroxyphenylacetaldehyde
3,4-dihydroxyphenylacetaldehyde
34dhpac
protocatechuatealdehyde
hmdb:HMDB0006256
hmdb:HMDB0006778
hmdb:HMDB03791
hmdb:HMDB06256
hmdb:HMDB06778
chebi:1385
chebi:19888
biggM:M_34dhpac
keggC:M_C04043
seedM:M_cpd02500
secondary/obsolete/fantasy identifier