Feedback

3,4-dihydroxyphenylacetaldehyde

Properties
MNX_IDMNXM1401
formulaC8H8O3
charge0
mass152.14732
referencechebi:27978
Image of MNXM1401
InChIKeyIADQVXRMSNIUEL-UHFFFAOYSA-N
InChIInChI=1S/C8H8O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,4-5,10-11H,3H2
SMILESOc1ccc(CC=O)cc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models9

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd02500 Protocatechuatealdehyde
3,4-Dihydroxyphenylacetaldehyde
3,4-dihydroxyphenylacetaldehyde
34dhpac
protocatechuatealdehyde
metacycM:34-DIHYDROXYPHENYLACETALDEHYDE 3,4-dihydroxyphenylacetaldehyde
protocatechuatealdehyde
chebi:27978 3,4-dihydroxyphenylacetaldehyde
(3,4-dihydroxyphenyl)acetaldehyde
2-(3,4-dihydroxyphenyl)ethanal
3,4-Dihydroxyphenylacetaldehyde
DOPAL
Protocatechuatealdehyde
keggC:C04043
sabiorkM:7037
3,4-Dihydroxyphenylacetaldehyde
Protocatechuatealdehyde
hmdb:HMDB0003791 3,4-Dihydroxyphenylacetaldehyde
2-(3,4-Dihydroxyphenyl)ethanal
2-(3,4-dihydroxyphenyl)acetaldehyde
3,4-Dihydroxy-benzeneacetaldehyde
DHPAA aldehyde
DOPAL
Protocatechuatealdehyde
dopal
biggM:34dhpac 3,4-Dihydroxyphenylacetaldehyde
biggM:M_34dhpac
chebi:1385
chebi:19888
hmdb:HMDB0006256
hmdb:HMDB0006778
hmdb:HMDB03791
hmdb:HMDB06256
hmdb:HMDB06778
keggC:M_C04043
seedM:M_cpd02500
secondary/obsolete/fantasy identifier