Feedback

 

3-phenylpropanoate

Image of MNXM1403
Properties
MNX_IDMNXM1403
formulaC9H9O2
charge-1
mass149.1671
referencechebi:51057
InChIKeyXMIIGOLPHOKFCH-UHFFFAOYSA-M
InChIInChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/p-1
SMILES[O-]C(=O)CCc1ccccc1

This chemical compound does not exist in my selection



Occurrences of 3-phenylpropanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:pppn Phenylpropanoate
chebi:20186
chebi:20187
chebi:51057
3-phenyl propionate
3-phenylpropanoate
3-phenylpropionate
XMIIGOLPHOKFCH-UHFFFAOYSA-M
chebi:26002
chebi:26005
chebi:28631
chebi:43112
chebi:8103
3-Phenyl-propionic acid
3-Phenylpropanoic acid
3-Phenylpropionsaeure
3-phenylpropanoic acid
3-phenylpropionic acid
3PP
HYDROCINNAMIC ACID
Hydrozimtsaeure
Phenylpropanoate
XMIIGOLPHOKFCH-UHFFFAOYSA-N
benzenepropanoic acid
benzenepropionic acid
benzylacetic acid
beta-phenylpropionic acid
dihydrocinnamic acid
envipath:...bdbb4fb60d5f 3-Phenylpropionate
envipath:...1f1754d887f6 compound 44232
hmdb:HMDB00764 3-phenylpropanoic acid
3-phenylpropionic acid
Hydrocinnamic acid
kegg:C05629 3-Phenyl-propionic acid
3-Phenylpropanoic acid
3-Phenylpropionic acid
Phenylpropanoate
metacyc:3-PHENYLPROPIONATE 3-PHENYLPROPIONATE
3-phenylpropanoate
3-phenylpropionate
3-phenylpropionic acid
HCA
hydrocinnamate
hydrocinnamic acid
phenylpropanoate
sabiork:20964 Hydrocinnamate
seed:cpd03343 3-Phenyl-propionic acid
3-Phenylpropanoic acid
Phenylpropanoate
pppn