Feedback

3-phenylpropanoate

Properties
MNX_IDMNXM1403
formulaC9H9O2
charge-1
mass149.16656
referencechebi:51057
Image of MNXM1403
InChIKeyXMIIGOLPHOKFCH-UHFFFAOYSA-M
InChIInChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/p-1
SMILES[O-]C(=O)CCc1ccccc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref16
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0000764 Hydrocinnamic acid
3-Phenyl-N-propionate
3-Phenyl-N-propionic acid
3-Phenyl-propionate
3-Phenyl-propionic acid
3-Phenylpropanoate
3-Phenylpropanoic acid
3-Phenylpropionate
3-Phenylpropionic acid
3-Phenylpropionic acid, sodium salt
3-Phenylpropionsaeure
3-phenylpropanoic acid
3-phenylpropionic acid
3PP
Benzenepropanoate
Benzenepropanoic acid
Benzenepropionate
Benzenepropionic acid
Benzylacetate
Benzylacetic acid
Dihydrocinnamate
Dihydrocinnamic acid
Hydrocinnamate
Hydrozimtsaeure
Omega-phenylpropanoate
Omega-phenylpropanoic acid
Phenylpropanoate
Phenylpropanoic acid
W-Phenylpropanoate
W-Phenylpropanoic acid
b-Phenylpropionate
b-Phenylpropionic acid
beta-Phenylpropionate
beta-Phenylpropionic acid
beta-phenylpropionate
beta-phenylpropionic acid
chebi:28631 3-phenylpropionic acid
3-Phenyl-propionic acid
3-Phenylpropanoic acid
3-Phenylpropionsaeure
3-phenylpropanoic acid
3PP
HYDROCINNAMIC ACID
Hydrozimtsaeure
Phenylpropanoate
benzenepropanoic acid
benzenepropionic acid
benzylacetic acid
beta-phenylpropionic acid
dihydrocinnamic acid
chebi:51057 3-phenylpropanoate
3-phenyl propionate
3-phenylpropionate
sabiorkM:20964 Hydrocinnamate
biggM:M_pppn
chebi:20186
chebi:20187
chebi:26002
chebi:26005
chebi:43112
chebi:8103
hmdb:HMDB00764
keggC:M_C05629
seedM:M_cpd03343
secondary/obsolete/fantasy identifier
sabiorkM:8019 Phenylpropanoate
3-Phenyl-propionic acid
3-Phenylpropanoic acid
metacycM:3-PHENYLPROPIONATE 3-phenylpropanoate
3-phenylpropionate
3-phenylpropionic acid
HCA
hydrocinnamate
hydrocinnamic acid
phenylpropanoate
keggC:C05629 Phenylpropanoate
3-Phenyl-propionic acid
3-Phenylpropanoate
3-Phenylpropanoic acid
3-Phenylpropionic acid
envipath:...bdbb4fb60d5f 3-Phenylpropionate
seedM:cpd03343 Phenylpropanoate
3-Phenyl-propionic acid
3-Phenylpropanoic acid
3-Phenylpropionic acid
3-phenylpropanoate
3-phenylpropionate
3-phenylpropionic acid
HCA
hydrocinnamate
hydrocinnamic acid
phenylpropanoate
pppn
biggM:pppn Phenylpropanoate
envipath:...1f1754d887f6 compound 44232
MNXM724355is deprecated and replaced by this entry