Feedback

4-(gamma-L-glutamylamino)butanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1406Image of MNXM1406
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 3
formulaC9H15N2O5
charge-1
mass231.22588
referencechebi:58800
InChIKeyMKYPKZSGLSOGLL-LURJTMIESA-M
InChIInChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/p-1/t6-/m0/s1
SMILES[NH3+][C@@H](CCC(=O)NCCCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58800
chebi:58800
4-(gamma-L-glutamylamino)butanoate
(2S)-2-ammonio-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate
(2S)-2-azaniumyl-4-[(3-carboxylatopropyl)carbamoyl]butanoate
(2S)-2-azaniumyl-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate
4-(L-gamma-glutamylamino)butanoate
N(5)-(3-carboxylatopropyl)-L-glutamine
hmdb:HMDB0012161 4-(Glutamylamino) butanoate
(2S)-2-amino-4-[(3-carboxypropyl)carbamoyl]butanoic acid
4-(L-Glutam-5-ylamino)butanoate
4-(L-Glutam-5-ylamino)butanoic acid
4-(L-gamma-glutamylamino)Butanoate
4-(L-gamma-glutamylamino)Butanoic acid
4-(glutamylamino) Butanoic acid
4-(glutamylamino)Butanoate
4-(glutamylamino)Butanoic acid
Glugaba
Glutamylgaba
N(5)-(3-Carboxypropyl)-L-glutamine
g Glutamyl gaba
g-Glutamyl-gaba
g-L-Glu-g-abu
g-L-Glutamyl-g-aminobutyrate
g-L-Glutamyl-g-aminobutyric acid
gamma Glutamyl gaba
gamma glutamyl gaba
gamma-Glu-gaba
gamma-Glutamyl-gaba
gamma-Glutamyl-gamma aminobutyric acid
gamma-Glutamyl-gamma-aminobutyrate
gamma-L-Glu-gamma-abu
gamma-L-Glutamyl-gamma-aminobutyrate
gamma-L-Glutamyl-gamma-aminobutyric acid
gamma-L-glu-gamma-abu
gamma-L-glutamyl-gamma-aminobutyrate
gamma-L-glutamyl-gamma-aminobutyric acid
gamma-glutamyl-gaba
glugaba
kegg.compound:C15767
keggC:C15767
4-(L-gamma-Glutamylamino)butanoate
4-(Glutamylamino)butanoate
4-(gamma-L-Glutamylamino)butanoate
gamma-Glutamyl-GABA
gamma-Glutamyl-gamma-aminobutyrate
CHEBI:49260
chebi:49260
4-(L-gamma-glutamylamino)butanoic acid
4-(Glutamylamino)butanoate
4-(L-glutam-5-ylamino)butanoic acid
Glugaba
Glutamylgaba
N(5)-(3-carboxypropyl)-L-glutamine
gamma Glutamyl GABA
gamma-Glutamyl-GABA
gamma-L-Glu-gamma-abu
gamma-L-Glutamyl-gamma-aminobutyric acid
gamma-glutamyl-GABA
metacyc.compound:CPD-9000
metacycM:CPD-9000
4-(gamma-L-glutamylamino)butanoate
4-(glutamylamino)butanoate
gamma-glu-GABA
gamma-glutamyl-gamma-aminobutanoate
gamma-glutamyl-gamma-aminobutyrate
gamma-glutamyl-gamma-aminobutyric acid
bigg.metabolite:gg4abut
biggM:gg4abut
Gamma-glutamyl-gamma aminobutyric acid
hmdb:HMDB0029393 L-N-(3-Carboxypropyl)glutamine
2-amino-4-[(3-carboxypropyl)-C-hydroxycarbonimidoyl]butanoic acid
S-N-(3-Carboxypropyl)glutamine
seed.compound:cpd11408
seedM:cpd11408
gamma-Glutamyl-GABA
4-(Glutamylamino)butanoate
4-(L-gamma-Glutamylamino)butanoate
4-(L-gamma-glutamylamino)butanoate
4-(gamma-L-glutamylamino)butanoate
4-(glutamylamino)butanoate
gamma-Glutamyl-gamma-aminobutyrate
gamma-glu-GABA
gamma-glutamyl-gamma aminobutyric acid
gamma-glutamyl-gamma-aminobutanoate
gamma-glutamyl-gamma-aminobutyrate
gamma-glutamyl-gamma-aminobutyric acid
ggluabt
hmdb:HMDB12161
hmdb:HMDB29393
biggM:M_gg4abut
keggC:M_C15767
seedM:M_cpd11408
secondary/obsolete/fantasy identifier