Feedback

4-(gamma-L-glutamylamino)butanoate

Properties
MNX_IDMNXM1406
formulaC9H15N2O5
charge-1
mass231.22588
referencechebi:58800
Image of MNXM1406
InChIKeyMKYPKZSGLSOGLL-LURJTMIESA-M
InChIInChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/p-1/t6-/m0/s1
SMILES[NH3+][C@@H](CCC(=O)NCCCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0029393 L-N-(3-Carboxypropyl)glutamine
2-amino-4-[(3-carboxypropyl)-C-hydroxycarbonimidoyl]butanoic acid
S-N-(3-Carboxypropyl)glutamine
biggM:gg4abut Gamma-glutamyl-gamma aminobutyric acid
metacycM:CPD-9000 4-(gamma-L-glutamylamino)butanoate
4-(glutamylamino)butanoate
gamma-glu-GABA
gamma-glutamyl-gamma-aminobutanoate
gamma-glutamyl-gamma-aminobutyrate
gamma-glutamyl-gamma-aminobutyric acid
seedM:cpd11408 gamma-Glutamyl-GABA
4-(Glutamylamino)butanoate
4-(L-gamma-Glutamylamino)butanoate
4-(L-gamma-glutamylamino)butanoate
4-(gamma-L-glutamylamino)butanoate
4-(glutamylamino)butanoate
gamma-Glutamyl-gamma-aminobutyrate
gamma-glu-GABA
gamma-glutamyl-gamma aminobutyric acid
gamma-glutamyl-gamma-aminobutanoate
gamma-glutamyl-gamma-aminobutyrate
gamma-glutamyl-gamma-aminobutyric acid
ggluabt
hmdb:HMDB0012161 4-(Glutamylamino) butanoate
(2S)-2-amino-4-[(3-carboxypropyl)carbamoyl]butanoic acid
4-(L-Glutam-5-ylamino)butanoate
4-(L-Glutam-5-ylamino)butanoic acid
4-(L-gamma-glutamylamino)Butanoate
4-(L-gamma-glutamylamino)Butanoic acid
4-(glutamylamino) Butanoic acid
4-(glutamylamino)Butanoate
4-(glutamylamino)Butanoic acid
Glugaba
Glutamylgaba
N(5)-(3-Carboxypropyl)-L-glutamine
g Glutamyl gaba
g-Glutamyl-gaba
g-L-Glu-g-abu
g-L-Glutamyl-g-aminobutyrate
g-L-Glutamyl-g-aminobutyric acid
gamma Glutamyl gaba
gamma glutamyl gaba
gamma-Glu-gaba
gamma-Glutamyl-gaba
gamma-Glutamyl-gamma aminobutyric acid
gamma-Glutamyl-gamma-aminobutyrate
gamma-L-Glu-gamma-abu
gamma-L-Glutamyl-gamma-aminobutyrate
gamma-L-Glutamyl-gamma-aminobutyric acid
gamma-L-glu-gamma-abu
gamma-L-glutamyl-gamma-aminobutyrate
gamma-L-glutamyl-gamma-aminobutyric acid
gamma-glutamyl-gaba
glugaba
chebi:49260 4-(L-gamma-glutamylamino)butanoic acid
4-(Glutamylamino)butanoate
4-(L-glutam-5-ylamino)butanoic acid
Glugaba
Glutamylgaba
N(5)-(3-carboxypropyl)-L-glutamine
gamma Glutamyl GABA
gamma-Glutamyl-GABA
gamma-L-Glu-gamma-abu
gamma-L-Glutamyl-gamma-aminobutyric acid
gamma-glutamyl-GABA
keggC:C15767 4-(L-gamma-Glutamylamino)butanoate
4-(Glutamylamino)butanoate
4-(gamma-L-Glutamylamino)butanoate
gamma-Glutamyl-GABA
gamma-Glutamyl-gamma-aminobutyrate
chebi:58800 4-(gamma-L-glutamylamino)butanoate
(2S)-2-ammonio-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate
(2S)-2-azaniumyl-4-[(3-carboxylatopropyl)carbamoyl]butanoate
(2S)-2-azaniumyl-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate
4-(L-gamma-glutamylamino)butanoate
N(5)-(3-carboxylatopropyl)-L-glutamine
biggM:M_gg4abut
hmdb:HMDB12161
hmdb:HMDB29393
keggC:M_C15767
seedM:M_cpd11408
secondary/obsolete/fantasy identifier
MNXM485432is deprecated and replaced by this entry
MNXM527793is deprecated and replaced by this entry