Feedback

4-phospho-D-erythronate

PropertiesImageOccurences in reactions
MNX_IDMNXM1407Image of MNXM1407
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 2
formulaC4H6O8P
charge-3
mass213.059401
referencechebi:58766
InChIKeyZCZXOHUILRHRQJ-PWNYCUMCSA-K
InChIInChI=1S/C4H9O8P/c5-2(3(6)4(7)8)1-12-13(9,10)11/h2-3,5-6H,1H2,(H,7,8)(H2,9,10,11)/p-3/t2-,3-/m1/s1
SMILESO[C@H](COP([O-])([O-])=O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58766
chebi:58766
4-phospho-D-erythronate
(2R,3R)-2,3-dihydroxy-4-(phosphononatooxy)butanoate
4-O-phosphonato-D-erythronate
4-O-phosphonato-D-erythronate(3-)
bigg.metabolite:4per
biggM:4per
sabiork.compound:6597
sabiorkM:6597
4-Phospho-D-erythronate
kegg.compound:C03393
keggC:C03393
4-Phospho-D-erythronate
4-Phosphoerythronate
seed.compound:cpd02147
seedM:cpd02147
4-Phosphoerythronate
4-Phospho-D-erythronate
4-phospho-D-erythronate
4-phosphoerythronate
4per
D-erythronate-4-phosphate
D-erythronate-4P
erythronate 4-phosphate
erythronate-4-phosphate
erythronate-4P
metacyc.compound:ERYTHRONATE-4P
metacycM:ERYTHRONATE-4P
4-phospho-D-erythronate
4-phosphoerythronate
D-erythronate-4-phosphate
D-erythronate-4P
erythronate 4-phosphate
erythronate-4P
CHEBI:49003
chebi:49003
4-phospho-D-erythronic acid
(2R,3R)-2,3-dihydroxy-4-(phosphonooxy)butanoic acid
4-O-phosphono-D-erythronic acid
4-PHOSPHO-D-ERYTHRONATE
4-Phospho-D-erythronate
4-Phosphoerythronate
CHEBI:49055
chebi:49055
4-phosphoerythronic acid
4-O-phosphonoerythronic acid
rel-(2R,3R)-2,3-dihydroxy-4-(phosphonooxy)butanoic acid
chebi:1924
chebi:41926
biggM:M_4per
keggC:M_C03393
seedM:M_cpd02147
secondary/obsolete/fantasy identifier