Feedback

5-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1410Image of MNXM1410
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 6
formulaC5H7O3
charge-1
mass115.04007
referencechebi:16120
InChIKeyVBKPPDYGFUZOAJ-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8)/p-1
SMILESO=CCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16120
chebi:16120
5-oxopentanoate
5-oxovalerate
bigg.metabolite:oxptn
biggM:oxptn
5-Oxopentanoate
seed.compound:cpd02089
seedM:cpd02089
5-Oxopentanoate
5-oxopentanoate
Glutarate semialdehyde
glusa
glutarate semialdehyde
sabiork.compound:2393
sabiorkM:2393
kegg.compound:C03273
keggC:C03273
5-Oxopentanoate
Glutarate semialdehyde
lipidmaps:LMFA01060161
lipidmapsM:LMFA01060161
5-oxo-pentanoic acid
5-oxo-pentanoic acid
FA 5:1
O
SLM:000000897
slm:000000897
5-oxopentanoate
CHEBI:39153
chebi:39153
5-oxopentanoic acid
2-formylethylacetic acid
4-formylbutyric acid
5-Oxo-valeriansaeure
5-Oxopentanoate
5-oxo-valeric acid
5-oxovaleric acid
Glutarate semialdehyde
hmdb:HMDB0012233 Glutarate semialdehyde
2-Formylethylacetate
2-Formylethylacetic acid
4-Formylbutyrate
4-Formylbutyric acid
5-Oxopentanoate
5-Oxopentanoic acid
5-Oxovalerate
5-Oxovaleric acid
5-oxo-Pentanoate
5-oxo-Pentanoic acid
5-oxo-Valerate
5-oxo-Valeriansaeure
5-oxo-Valeric acid
5-oxopentanoic acid
Glutaric acid semialdehyde
envipath:...6236f2ab29aa
envipathM:...6236f2ab29aa
compound 38220
metacyc.compound:CPD-280
metacycM:CPD-280
glutarate semialdehyde
5-oxopentanoate
hmdb:HMDB12233
chebi:12156
chebi:14323
chebi:20623
chebi:2115
chebi:24328
chebi:39151
biggM:M_oxptn
keggC:M_C03273
seedM:M_cpd02089
secondary/obsolete/fantasy identifier