Feedback

5-oxopentanoate

Properties
MNX_IDMNXM1410
formulaC5H7O3
charge-1
mass115.10728
referencechebi:16120
Image of MNXM1410
InChIKeyVBKPPDYGFUZOAJ-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8)/p-1
SMILES[O-]C(=O)CCCC=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:16120 5-oxopentanoate
5-oxovalerate
chebi:39153 5-oxopentanoic acid
2-formylethylacetic acid
4-formylbutyric acid
5-Oxo-valeriansaeure
5-Oxopentanoate
5-oxo-valeric acid
5-oxovaleric acid
Glutarate semialdehyde
envipath:...6236f2ab29aa compound 38220
keggC:C03273
sabiorkM:2393
5-Oxopentanoate
Glutarate semialdehyde
seedM:cpd02089 5-Oxopentanoate
5-oxopentanoate
Glutarate semialdehyde
glusa
glutarate semialdehyde
metacycM:CPD-280 glutarate semialdehyde
5-oxopentanoate
hmdb:HMDB0012233 Glutarate semialdehyde
2-Formylethylacetate
2-Formylethylacetic acid
4-Formylbutyrate
4-Formylbutyric acid
5-Oxopentanoate
5-Oxopentanoic acid
5-Oxovalerate
5-Oxovaleric acid
5-oxo-Pentanoate
5-oxo-Pentanoic acid
5-oxo-Valerate
5-oxo-Valeriansaeure
5-oxo-Valeric acid
5-oxopentanoic acid
Glutaric acid semialdehyde
biggM:oxptn 5-Oxopentanoate
lipidmaps:LMFA01060161 5-oxo-pentanoic acid
5-oxo-pentanoic acid
FA(5:0(Ke))
biggM:M_oxptn
chebi:12156
chebi:14323
chebi:20623
chebi:2115
chebi:24328
chebi:39151
hmdb:HMDB12233
keggC:M_C03273
seedM:M_cpd02089
secondary/obsolete/fantasy identifier
slm:000000897 5-oxopentanoate
MNXM724028is deprecated and replaced by this entry