|
![]() |
InChIKey | UIJIQXGRFSPYQW-UHFFFAOYSA-N |
InChI | InChI=1S/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-3H,1H3,(H,7,8,9,10) |
SMILES | CSc1ncnc2[nH]cnc12 |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 2 |
Distinct compatimentalized reactions in models | 1 |
Identifier | Description |
---|---|
seedM:cpd02228 | Thiopurine S-methylether 6-Methylmercaptopurine |
keggC:C16614 | 6-Methylmercaptopurine Thiopurine S-methylether |
chebi:28279 reactome:R-ALL-158611 reactome:R-ALL-76384 | 6-methylthiopurine 6-(methylsulfanyl)-9H-purine 6-Methylmercaptopurine 6-Methylthiopurine Thiopurine S-methylether |
hmdb:HMDB0060412 | 6-Methylmercaptopurine 6-(methylsulfanyl)-9H-purine 6-methylthiopurine Methylmercaptopurine Thiopurine S-methylether |
seedM:cpd16418 | 6-Methylmercaptopurine |
metacycM:Thiopurine-Methylethers | a thiopurine S-methylether |
chebi:26973 chebi:29131 chebi:9564 hmdb:HMDB60412 keggC:M_C16614 seedM:M_cpd02228 seedM:M_cpd16418 seedM:M_cpd28263 | secondary/obsolete/fantasy identifier |
seedM:cpd28263 | Thiopurine-Methylethers |
MNXM22052 | is deprecated and replaced by this entry |
MNXM22053 | is deprecated and replaced by this entry |
MNXM723005 | is deprecated and replaced by this entry |
MNXM90153 | is deprecated and replaced by this entry |