Feedback

L-threonine

PropertiesImageOccurences in reactions
MNX_IDMNXM142Image of MNXM142
#reac
in my sandbox 0
in MNXref (generic)231
in models (compartimentalized) 333
formulaC4H9NO3
charge0
mass119.05824
referencechebi:57926
InChIKeyAYFVYJQAPQTCCC-GBXIJSLDSA-N
InChIInChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1
SMILESC[C@@H](O)[C@H]([NH3+])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-351990
reactomeM:R-ALL-351990
reactome:R-ALL-352000
reactomeM:R-ALL-352000
reactome:R-ALL-379706
reactomeM:R-ALL-379706
CHEBI:57926
chebi:57926
L-threonine
(2S,3R)-2-ammonio-3-hydroxybutanoate
(2S,3R)-2-azaniumyl-3-hydroxybutanoate
L-threonine zwitterion
bigg.metabolite:thr__L
biggM:thr__L
envipath:...6ac1b121dc59
envipathM:...6ac1b121dc59
L-Threonine
hmdb:HMDB0000167 L-Threonine
(2S)-Threonine
(2S,3R)-(-)-Threonine
(2S,3R)-2-Amino-3-hydroxybutanoate
(2S,3R)-2-Amino-3-hydroxybutanoic acid
(2S,3R)-2-Amino-3-hydroxybutyrate
(2S,3R)-2-Amino-3-hydroxybutyric acid
(2S,3R)-2-amino-3-hydroxybutanoic acid
(R-(R*,s*))-2-amino-3-hydroxybutanoate
(R-(R*,s*))-2-amino-3-hydroxybutanoic acid
(S)-Threonine
2-Amino-3-hydroxybutanoate
2-Amino-3-hydroxybutanoic acid
2-Amino-3-hydroxybutyrate
2-Amino-3-hydroxybutyric acid
L Threonine
L-(-)-Threonine
L-2-Amino-3-hydroxybutyrate
L-2-Amino-3-hydroxybutyric acid
L-Threonin
L-a-Amino-b-hydroxybutyrate
L-a-Amino-b-hydroxybutyric acid
L-alpha-Amino-beta-hydroxybutyrate
L-alpha-Amino-beta-hydroxybutyric acid
L-alpha-amino-beta-hydroxybutyrate
L-alpha-amino-beta-hydroxybutyric acid
L-threonine
T
THREONINE
Thr
Threonin
[R-(R*,s*)]-2-amino-3-hydroxy-butanoate
[R-(R*,s*)]-2-amino-3-hydroxy-butanoic acid
[R-(R*,s*)]-2-amino-3-hydroxybutanoate
[R-(R*,s*)]-2-amino-3-hydroxybutanoic acid
kegg.compound:C00188
keggC:C00188
L-Threonine
2-Amino-3-hydroxybutyric acid
seed.compound:cpd00161
seedM:cpd00161
L-Threonine
2-Amino-3-hydroxybutyric acid
2-amino-3-hydroxybutyric acid
L-thr
L-threonine
thr
thr-L
thre
threonine
sabiork.compound:76
sabiorkM:76
L-Threonine
2-Amino-3-hydroxybutyric acid
3-Methyl-L-serine
Thr
CHEBI:32820
chebi:32820
L-threoninate
(2S,3R)-2-amino-3-hydroxybutanoate
L-threonine anion
CHEBI:16857
chebi:16857
L-threonine
(2S)-threonine
(2S,3R)-(-)-Threonine
(2S,3R)-2-amino-3-hydroxybutanoic acid
2-Amino-3-hydroxybutyric acid
L-(-)-Threonine
L-2-Amino-3-hydroxybutyric acid
L-Threonin
L-Threonine
L-alpha-amino-beta-hydroxybutyric acid
T
THREONINE
Thr
metacyc.compound:THR
metacycM:THR
L-threonine
2-amino-3-hydroxybutyric acid
L-thr
T
thr
thre
threonine
CHEBI:32822
chebi:32822
L-threoninium
(1S,2R)-1-carboxy-2-hydroxypropan-1-aminium
L-threonine cation
sabiork.compound:27463
sabiorkM:27463
Threonine
kegg.drug:D00041
keggD:D00041
Threonine (USP)
L-Threonine (JP18)
CHEBI:32832
chebi:32832
threoninate
rel-(2R,3S)-2-amino-3-hydroxybutanoate
threonine anion
CHEBI:26986
chebi:26986
threonine
Threonin
CHEBI:32833
chebi:32833
threoninium
rel-(1R,2S)-1-carboxy-2-hydroxypropan-1-aminium
threonine cation
biggM:thr-L
hmdb:HMDB00167
chebi:13175
chebi:21403
chebi:42083
chebi:45843
chebi:45983
chebi:6308
biggM:M_thr__L
keggC:M_C00188
keggD:M_D00041
seedM:M_cpd00161
secondary/obsolete/fantasy identifier