Feedback

N-hydroxy-2-acetamidofluorene

PropertiesImageOccurences in reactions
MNX_IDMNXM1437Image of MNXM1437
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC15H13NO2
charge0
mass239.26926
referencechebi:17931
InChIKeySOKUIEGXJHVFDV-UHFFFAOYSA-N
InChIInChI=1S/C15H13NO2/c1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9,18H,8H2,1H3
SMILESCC(=O)N(O)c1ccc-2c(Cc3ccccc-23)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-176566
reactomeM:R-ALL-176566
CHEBI:17931
chebi:17931
N-hydroxy-2-acetamidofluorene
2-(N-Acetylhydroxylamino)fluorene
2-(N-Hydroxyacetamido)fluorene
Fluorenyl-2-acethydroxamic acid
Hydroxyacetylaminofluorene
N-(9H-fluoren-2-yl)-N-hydroxyacetamide
N-Fluoren-2-ylacetohydroxamic acid
N-Hydroxy-2-acetamidofluorene
N-Hydroxy-N-acetyl-2-aminofluorene
kegg.compound:C03954
keggC:C03954
N-Hydroxy-2-acetamidofluorene
seed.compound:cpd02455
seedM:cpd02455
N-Hydroxy-2-acetamidofluorene
N-hydroxy-2-acetamidofluorene
metacyc.compound:N-HYDROXY-2-ACETAMIDOFLUORENE
metacycM:N-HYDROXY-2-ACETAMIDOFLUORENE
N-hydroxy-2-acetamidofluorene
chebi:12511
chebi:12599
chebi:21734
chebi:7294
keggC:M_C03954
seedM:M_cpd02455
secondary/obsolete/fantasy identifier