This is version 4.2 of MetaNetX/MNXref
 Feedback

beta-alanine

PropertiesImageOccurences in reactions
MNX_IDMNXM144Image of MNXM144
#reac
in my sandbox 0
in MNXref (generic)63
in models (compartimentalized) 29
formulaC3H7NO2
charge0
mass89.09322
referencechebi:57966
InChIKeyUCMIRNVEIXFBKS-UHFFFAOYSA-N
InChIInChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)
SMILES[NH3+]CCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57966
chebi:57966
beta-alanine
3-ammoniopropanoate
3-azaniumylpropanoate
beta-alanine zwitterion
bigg.metabolite:ala_B
biggM:ala_B
Beta-Alanine
hmdb:HMDB0000056 beta-Alanine
2-Carboxyethylamine
3 Aminopropionic acid
3-Aminopropanoate
3-Aminopropanoic acid
3-Aminopropionate
3-Aminopropionic acid
3-amino-Propanoate
3-amino-Propanoic acid
3-aminopropanoic acid
Abufene
BAla
H-b-Ala-OH
H-beta-Ala-OH
H-beta-ala-OH
Omega-aminopropionate
Omega-aminopropionic acid
b-Alanine
b-Aminopropanoate
b-Aminopropanoic acid
b-Aminopropionate
b-Aminopropionic acid
beta Alanine
beta alanine
beta-Aminopropanoate
beta-Aminopropanoic acid
beta-Aminopropionate
beta-Aminopropionic acid
beta-alanine
beta-aminopropionate
beta-aminopropionic acid
kegg.compound:C00099
keggC:C00099
beta-Alanine
3-Aminopropanoate
3-Aminopropionic acid
seed.compound:cpd00085
seedM:cpd00085
beta-Alanine
3-Aminopropanoate
3-Aminopropionic acid
3-aminopropanoate
3-ammoniopropanoate
3-azaniumylpropanoate
ala-B
beta-alanine
sabiork.compound:1932
sabiorkM:1932
beta-Alanine
3-Aminopropanoate
3-Aminopropionic acid
3-aminopropionic acid
kegg.drug:D07561
keggD:D07561
beta-Alanine
Abufene (TN)
CHEBI:63070
chebi:63070
beta-alaninate
3-aminopropanoate
beta-alaninate anion
beta-alaninate(1-)
reactome:R-ALL-352021
reactomeM:R-ALL-352021
reactome:R-ALL-73590
reactomeM:R-ALL-73590
reactome:R-ALL-909777
reactomeM:R-ALL-909777
CHEBI:16958
chebi:16958
beta-alanine
3-Aminopropionic acid
3-aminopropanoic acid
BETA-ALANINE
H-beta-Ala-OH
bAla
beta-Alanine
beta-aminopropionic acid
omega-aminopropionic acid
metacyc.compound:B-ALANINE
metacycM:B-ALANINE
beta-alanine
3-ammoniopropanoate
3-azaniumylpropanoate
envipath:...87b5b436f4df
envipathM:...87b5b436f4df
compound 38219
hmdb:HMDB00056
chebi:10343
chebi:12389
chebi:22821
chebi:41050
biggM:M_ala_B
keggC:M_C00099
keggD:M_D07561
seedM:M_cpd00085
secondary/obsolete/fantasy identifier