Feedback

(2S,3S)-3-methyl-L-aspartate

PropertiesImageOccurences in reactions
MNX_IDMNXM1444Image of MNXM1444
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC5H8NO4
charge-1
mass146.12136
referencechebi:58724
InChIKeyLXRUAYBIUSUULX-HRFVKAFMSA-M
InChIInChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/p-1/t2-,3-/m0/s1
SMILESC[C@@H]([C@H]([NH3+])C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58724
chebi:58724
(2S,3S)-3-methyl-L-aspartate
(2S,3S)-2-azaniumyl-3-methylbutanedioate
threo-3-methyl-L-aspartate(1-)
metacyc.compound:L-THREO-3-METHYL-ASPARTATE
metacycM:L-THREO-3-METHYL-ASPARTATE
(2S, 3S)-3-methylaspartate
L-threo-3-methyl-aspartate
L-threo-3-methylaspartate
beta-methylaspartate
sabiork.compound:6741
sabiorkM:6741
L-threo-3-Methylaspartate
seed.compound:cpd02273
seedM:cpd02273
L-threo-3-Methylaspartate
(2S, 3S)-3-methylaspartate
L-threo-3-methyl-aspartate
L-threo-3-methylaspartate
beta-methylaspartate
kegg.compound:C03618
keggC:C03618
L-threo-3-Methylaspartate
(2S,3S)-3-Methylaspartate
CHEBI:16378
chebi:16378
threo-3-methyl-L-aspartate(2-)
(2S,3S)-2-amino-3-methylbutanedioate
(3S)-3-methyl-L-aspartate
CHEBI:47980
chebi:47980
threo-3-methyl-L-aspartic acid
(2S,3S)-2-amino-3-methylbutanedioic acid
(3S)-3-methyl-L-aspartic acid
2S,3S-3-METHYLASPARTIC ACID
L-threo-3-Methylaspartate
chebi:13066
chebi:21399
chebi:39908
chebi:6334
keggC:M_C03618
seedM:M_cpd02273
secondary/obsolete/fantasy identifier