Feedback

(2Z,4Z)-2-hydroxyhexa-2,4-dienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1448Image of MNXM1448
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC6H7O3
charge-1
mass127.11798
referencechebi:63693
InChIKeyVPGPQVKJUYKKNN-LDIADDGTSA-M
InChIInChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-4,7H,1H3,(H,8,9)/p-1/b3-2-,5-4-
SMILESC\C=C/C=C(\O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:63693
chebi:63693
(2Z,4Z)-2-hydroxyhexa-2,4-dienoate
(Z,Z)-2-hydroxyhexa-2,4-dienoate
kegg.compound:C20240
keggC:C20240
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoate
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoic acid
seed.compound:cpd21473
seedM:cpd21473
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoate
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoic acid
(2Z,4Z)-2-hydroxyhexa-2,4-dienoate
metacyc.compound:CPD-13712
metacycM:CPD-13712
(2Z,4Z)-2-hydroxyhexa-2,4-dienoate
lipidmaps:LMFA01030943
lipidmapsM:LMFA01030943
(2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(Z,Z)-2-hydroxyhexa-2,4-dienoic acid
FA(6:2(OH))
CHEBI:63735
chebi:63735
(2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(Z,Z)-2-hydroxyhexa-2,4-dienoic acid
keggC:M_C20240
seedM:M_cpd21473
secondary/obsolete/fantasy identifier