Feedback

(2Z,4Z)-2-hydroxyhexa-2,4-dienoate

Properties
MNX_IDMNXM1448
formulaC6H7O3
charge-1
mass127.11798
referencechebi:63693
Image of MNXM1448
InChIKeyVPGPQVKJUYKKNN-LDIADDGTSA-M
InChIInChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-4,7H,1H3,(H,8,9)/p-1/b3-2-,5-4-
SMILESC\C=C/C=C(\O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:63693 (2Z,4Z)-2-hydroxyhexa-2,4-dienoate
(Z,Z)-2-hydroxyhexa-2,4-dienoate
lipidmaps:LMFA01030943 (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(Z,Z)-2-hydroxyhexa-2,4-dienoic acid
FA(6:2(OH))
metacycM:CPD-13712 (2Z,4Z)-2-hydroxyhexa-2,4-dienoate
keggC:M_C20240
seedM:M_cpd21473
secondary/obsolete/fantasy identifier
chebi:63735 (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid
(Z,Z)-2-hydroxyhexa-2,4-dienoic acid
keggC:C20240 (2Z,4Z)-2-Hydroxyhexa-2,4-dienoate
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoic acid
seedM:cpd21473 (2Z,4Z)-2-Hydroxyhexa-2,4-dienoate
(2Z,4Z)-2-Hydroxyhexa-2,4-dienoic acid
(2Z,4Z)-2-hydroxyhexa-2,4-dienoate